The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912224, 359 ID: ALA3662034
PubChem CID: 91754904
Max Phase: Preclinical
Molecular Formula: C27H28N4O3S
Molecular Weight: 488.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1nccc1CNC(=O)c1cnc(Oc2cc3c(cc2C)OC(c2ccccc2C)CC3)s1
Standard InChI: InChI=1S/C27H28N4O3S/c1-4-31-20(11-12-30-31)15-28-26(32)25-16-29-27(35-25)34-23-14-19-9-10-22(33-24(19)13-18(23)3)21-8-6-5-7-17(21)2/h5-8,11-14,16,22H,4,9-10,15H2,1-3H3,(H,28,32)
Standard InChI Key: HZVFFKQPHXREKK-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
7.0656 9.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8170 8.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3927 7.6312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1731 8.5044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9657 7.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4392 6.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9262 6.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8143 5.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2115 3.6348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0996 2.4249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2924 2.5566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4979 1.0528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2524 -0.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2526 -1.3618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8978 3.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1957 2.9983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4960 3.7463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4983 5.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2005 5.9983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9003 5.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8620 5.8521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0317 0.7359 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 3 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 19 2 0
24 25 1 0
25 26 2 0
26 17 1 0
26 27 1 0
22 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
33 34 1 0
15 35 1 0
35 12 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.61Molecular Weight (Monoisotopic): 488.1882AlogP: 5.76#Rotatable Bonds: 7Polar Surface Area: 78.27Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.02CX Basic pKa: 2.03CX LogP: 5.59CX LogD: 5.59Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.02
References 1. (2014) Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals,