US8912224, 359

ID: ALA3662034

PubChem CID: 91754904

Max Phase: Preclinical

Molecular Formula: C27H28N4O3S

Molecular Weight: 488.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCn1nccc1CNC(=O)c1cnc(Oc2cc3c(cc2C)OC(c2ccccc2C)CC3)s1

Standard InChI:  InChI=1S/C27H28N4O3S/c1-4-31-20(11-12-30-31)15-28-26(32)25-16-29-27(35-25)34-23-14-19-9-10-22(33-24(19)13-18(23)3)21-8-6-5-7-17(21)2/h5-8,11-14,16,22H,4,9-10,15H2,1-3H3,(H,28,32)

Standard InChI Key:  HZVFFKQPHXREKK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    7.0656    9.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8170    8.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3927    7.6312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1731    8.5044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9657    7.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4392    6.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9262    6.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8143    5.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2115    3.6348    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0996    2.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2924    2.5566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4979    1.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2524   -0.2436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2526   -1.3618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2991    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8978    3.7504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1957    2.9983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4960    3.7463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4983    5.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2005    5.9983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9003    5.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8620    5.8521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0317    0.7359    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  3  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 19  2  0
 24 25  1  0
 25 26  2  0
 26 17  1  0
 26 27  1  0
 22 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 33 34  1  0
 15 35  1  0
 35 12  1  0
M  END

Associated Targets(Human)

SLC8A1 Tchem Sodium/calcium exchanger 1 (416 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.61Molecular Weight (Monoisotopic): 488.1882AlogP: 5.76#Rotatable Bonds: 7
Polar Surface Area: 78.27Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.02CX Basic pKa: 2.03CX LogP: 5.59CX LogD: 5.59
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.02

References

1.  (2014)  Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals, 

Source

Source(1):