The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912224, 362 ID: ALA3662037
PubChem CID: 91754907
Max Phase: Preclinical
Molecular Formula: C26H25FN4O4S
Molecular Weight: 508.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1nccc1CNC(=O)c1cnc(Oc2ccc3c(c2)CCC(c2cccc(OC)c2F)O3)s1
Standard InChI: InChI=1S/C26H25FN4O4S/c1-3-31-17(11-12-30-31)14-28-25(32)23-15-29-26(36-23)34-18-8-10-20-16(13-18)7-9-21(35-20)19-5-4-6-22(33-2)24(19)27/h4-6,8,10-13,15,21H,3,7,9,14H2,1-2H3,(H,28,32)
Standard InChI Key: UDMNHKWYGOQFFI-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-4.4953 -10.7541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6030 -9.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9124 -8.4859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2785 -7.8662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1113 -6.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6419 -6.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9227 -7.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4309 -7.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5420 -6.3307 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9498 -6.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4321 -7.5937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8372 -5.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3372 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 -3.8679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1968 1.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4948 0.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7950 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7974 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4995 3.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5050 5.2492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5460 5.8460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1610 3.6021 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 -3.8595 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 3 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 20 1 0
25 26 2 0
26 17 1 0
22 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 1 0
31 34 2 0
34 27 1 0
34 35 1 0
15 36 1 0
36 12 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.58Molecular Weight (Monoisotopic): 508.1581AlogP: 5.30#Rotatable Bonds: 8Polar Surface Area: 87.50Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.92CX Basic pKa: 2.03CX LogP: 4.55CX LogD: 4.55Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -1.12
References 1. (2014) Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals,