US8912224, 363

ID: ALA3662038

PubChem CID: 91754908

Max Phase: Preclinical

Molecular Formula: C24H21N3O4S

Molecular Weight: 447.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1Cc2cc(Oc3ncc(C(=O)NCc4ccno4)s3)ccc2OC1c1ccccc1

Standard InChI:  InChI=1S/C24H21N3O4S/c1-15-11-17-12-18(7-8-20(17)30-22(15)16-5-3-2-4-6-16)29-24-26-14-21(32-24)23(28)25-13-19-9-10-27-31-19/h2-10,12,14-15,22H,11,13H2,1H3,(H,25,28)

Standard InChI Key:  IHXSMULWNGDPEV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2991    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3022    5.2508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6030    5.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7460    7.4797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2143    7.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9598    6.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9522    5.3736    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4489    6.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1594    7.2871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0526    4.9459    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5443    4.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1480    3.4067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6043    3.1046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7506    1.6117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3761    1.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3802    2.1329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2978   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2955   -5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0048   -6.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3026   -5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3002   -3.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 11 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  2  0
  6 22  2  0
 22 23  1  0
 23 24  2  0
 24  4  1  0
 24 25  1  0
 25 26  1  0
 26  2  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Associated Targets(Human)

SLC8A1 Tchem Sodium/calcium exchanger 1 (416 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.52Molecular Weight (Monoisotopic): 447.1253AlogP: 5.17#Rotatable Bonds: 6
Polar Surface Area: 86.48Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.07CX Basic pKa: CX LogP: 4.51CX LogD: 4.51
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.76

References

1.  (2014)  Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals, 

Source

Source(1):