The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912224, 367 ID: ALA3662042
PubChem CID: 91754912
Max Phase: Preclinical
Molecular Formula: C22H21FN2O5S
Molecular Weight: 444.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(F)cccc1C1CCc2cc(Oc3ncc(C(=O)NCCO)s3)ccc2O1
Standard InChI: InChI=1S/C22H21FN2O5S/c1-28-20-15(3-2-4-16(20)23)18-7-5-13-11-14(6-8-17(13)30-18)29-22-25-12-19(31-22)21(27)24-9-10-26/h2-4,6,8,11-12,18,26H,5,7,9-10H2,1H3,(H,24,27)
Standard InChI Key: DLQIYAUYZYCFFY-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
2.8593 1.3486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8984 0.7484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2371 -0.9062 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1984 1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 0.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8506 1.3617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.8505 0.2435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0959 -1.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6298 -0.7359 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-8.6977 -2.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8905 -2.5567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8096 -3.6348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.4124 -5.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5243 -6.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0062 -7.3180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
4 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 3 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 17 1 0
20 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
15 28 2 0
28 29 1 0
29 30 2 0
30 13 1 0
30 31 1 0
31 10 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.48Molecular Weight (Monoisotopic): 444.1155AlogP: 3.87#Rotatable Bonds: 7Polar Surface Area: 89.91Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.33CX Basic pKa: ┄CX LogP: 3.43CX LogD: 3.43Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.58Np Likeness Score: -0.44
References 1. (2014) Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals,