US8912224, 367

ID: ALA3662042

PubChem CID: 91754912

Max Phase: Preclinical

Molecular Formula: C22H21FN2O5S

Molecular Weight: 444.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1c(F)cccc1C1CCc2cc(Oc3ncc(C(=O)NCCO)s3)ccc2O1

Standard InChI:  InChI=1S/C22H21FN2O5S/c1-28-20-15(3-2-4-16(20)23)18-7-5-13-11-14(6-8-17(13)30-18)29-22-25-12-19(31-22)21(27)24-9-10-26/h2-4,6,8,11-12,18,26H,5,7,9-10H2,1H3,(H,24,27)

Standard InChI Key:  DLQIYAUYZYCFFY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    2.8593    1.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8984    0.7484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2371   -0.9062    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1984    1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971    0.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8506    1.3617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8505    0.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0959   -1.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6298   -0.7359    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6977   -2.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8905   -2.5567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8096   -3.6348    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4124   -5.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5243   -6.2191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0062   -7.3180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  4  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  3  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  1  0
 20 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 15 28  2  0
 28 29  1  0
 29 30  2  0
 30 13  1  0
 30 31  1  0
 31 10  1  0
M  END

Associated Targets(Human)

SLC8A1 Tchem Sodium/calcium exchanger 1 (416 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.48Molecular Weight (Monoisotopic): 444.1155AlogP: 3.87#Rotatable Bonds: 7
Polar Surface Area: 89.91Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.33CX Basic pKa: CX LogP: 3.43CX LogD: 3.43
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.58Np Likeness Score: -0.44

References

1.  (2014)  Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals, 

Source

Source(1):