US8912224, 75

ID: ALA3662044

PubChem CID: 91755087

Max Phase: Preclinical

Molecular Formula: C30H28N4O4S

Molecular Weight: 540.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NC(=O)c1cnc(Oc2ccc3c(c2)CC[C@@H](c2ccccc2)O3)s1)c1ccnc(N2CCCCC2)c1

Standard InChI:  InChI=1S/C30H28N4O4S/c35-28(22-13-14-31-27(18-22)34-15-5-2-6-16-34)33-29(36)26-19-32-30(39-26)37-23-10-12-25-21(17-23)9-11-24(38-25)20-7-3-1-4-8-20/h1,3-4,7-8,10,12-14,17-19,24H,2,5-6,9,11,15-16H2,(H,33,35,36)/t24-/m0/s1

Standard InChI Key:  YQQWTBNBPOCFTN-DEOSSOPVSA-N

Molfile:  

     RDKit          2D

 39 44  0  0  1  0  0  0  0  0999 V2000
   -0.9486   -8.6388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4309   -7.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5420   -6.3307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9498   -6.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4321   -7.5937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -5.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3372   -5.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8056   -3.8679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1968    1.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971    0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7950    1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7926    3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4924    3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1945    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786   -3.8595    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9227   -7.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8129   -8.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3036   -8.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9041   -7.0414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0140   -5.8340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5234   -6.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6149   -4.4588    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1053   -4.2892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7037   -2.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8117   -1.7078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3213   -1.8773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7229   -3.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 14  1  0
 19 20  2  0
 20 11  1  0
 16 21  1  1
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
  9 27  1  0
 27  6  1  0
  2 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 32 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 34  1  0
M  END

Associated Targets(Human)

SLC8A1 Tchem Sodium/calcium exchanger 1 (416 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.65Molecular Weight (Monoisotopic): 540.1831AlogP: 5.96#Rotatable Bonds: 6
Polar Surface Area: 93.65Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.72CX Basic pKa: 4.46CX LogP: 6.09CX LogD: 5.92
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.30Np Likeness Score: -0.90

References

1.  (2014)  Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals, 

Source

Source(1):