The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912224, 108 ID: ALA3662045
PubChem CID: 71292893
Max Phase: Preclinical
Molecular Formula: C27H30N2O2S
Molecular Weight: 446.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(C2CCc3cc(Oc4ncc(CN5CC6CCC(CC6)C5)s4)ccc3O2)cc1
Standard InChI: InChI=1S/C27H30N2O2S/c1-2-4-21(5-3-1)25-12-10-22-14-23(11-13-26(22)31-25)30-27-28-15-24(32-27)18-29-16-19-6-7-20(17-29)9-8-19/h1-5,11,13-15,19-20,25H,6-10,12,16-18H2
Standard InChI Key: USSYNOMXGPHSRR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
0.9498 -6.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5420 -6.3307 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9534 -6.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2769 -5.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5893 -6.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8476 -5.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2851 -4.4883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1716 -3.2158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3100 -4.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6248 -5.7805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8372 -5.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3372 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 -3.8679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1968 1.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4995 3.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7974 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7950 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4948 0.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 -3.8595 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 4 1 0
7 10 1 0
10 2 1 0
1 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 19 1 0
24 25 2 0
25 16 1 0
21 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
14 32 1 0
32 11 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.62Molecular Weight (Monoisotopic): 446.2028AlogP: 6.62#Rotatable Bonds: 5Polar Surface Area: 34.59Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.22CX LogP: 6.56CX LogD: 5.68Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.36
References 1. (2014) Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals,