The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912224, 179 ID: ALA3662049
PubChem CID: 91755090
Max Phase: Preclinical
Molecular Formula: C27H25N3O3S
Molecular Weight: 471.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1C1CCc2cc(Oc3nc(C)c(C(=O)NCc4ccncc4)s3)ccc2O1
Standard InChI: InChI=1S/C27H25N3O3S/c1-17-5-3-4-6-22(17)24-9-7-20-15-21(8-10-23(20)33-24)32-27-30-18(2)25(34-27)26(31)29-16-19-11-13-28-14-12-19/h3-6,8,10-15,24H,7,9,16H2,1-2H3,(H,29,31)
Standard InChI Key: PPCIMFYHMLRWDC-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
3.9010 0.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1984 1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 0.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8506 1.3617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.8505 0.2435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0443 0.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0959 -1.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6298 -0.7359 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-8.6977 -2.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8905 -2.5567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8096 -3.6348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.4124 -5.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5243 -6.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1247 -7.5937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2346 -8.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7440 -8.6339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1434 -7.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0335 -6.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
17 19 2 0
19 20 1 0
20 15 1 0
19 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
13 31 2 0
31 32 1 0
32 33 2 0
33 11 1 0
33 34 1 0
34 8 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.58Molecular Weight (Monoisotopic): 471.1617AlogP: 5.94#Rotatable Bonds: 6Polar Surface Area: 73.34Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.11CX Basic pKa: 5.02CX LogP: 5.29CX LogD: 5.28Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -0.85
References 1. (2014) Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals,