US8912224, 188

ID: ALA3662050

PubChem CID: 71293071

Max Phase: Preclinical

Molecular Formula: C25H24N2O5S

Molecular Weight: 464.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1(NC(=O)c2cnc(Oc3ccc4c(c3)CC[C@@H](c3ccccc3)O4)s2)CC1

Standard InChI:  InChI=1S/C25H24N2O5S/c1-2-30-23(29)25(12-13-25)27-22(28)21-15-26-24(33-21)31-18-9-11-20-17(14-18)8-10-19(32-20)16-6-4-3-5-7-16/h3-7,9,11,14-15,19H,2,8,10,12-13H2,1H3,(H,27,28)/t19-/m0/s1

Standard InChI Key:  MKWXALUUTTZQAV-IBGZPJMESA-N

Molfile:  

     RDKit          2D

 33 37  0  0  1  0  0  0  0  0999 V2000
   -1.8253  -12.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1149  -11.4991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7173  -10.1245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8288   -8.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3640   -9.0470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4311   -7.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6725   -8.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5072   -6.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5420   -6.3307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9498   -6.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4321   -7.5937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -5.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3372   -5.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8056   -3.8679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1968    1.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971    0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7950    1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7926    3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4924    3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1945    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786   -3.8595    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  6  1  0
  6  9  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 20  1  0
 25 26  2  0
 26 17  1  0
 22 27  1  1
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 15 33  1  0
 33 12  1  0
M  END

Associated Targets(Human)

SLC8A1 Tchem Sodium/calcium exchanger 1 (416 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.54Molecular Weight (Monoisotopic): 464.1406AlogP: 4.83#Rotatable Bonds: 7
Polar Surface Area: 86.75Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.52CX Basic pKa: CX LogP: 4.81CX LogD: 4.81
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.37

References

1.  (2014)  Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals, 

Source

Source(1):