The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8912224, 151 ID: ALA3662052
PubChem CID: 91755092
Max Phase: Preclinical
Molecular Formula: C24H23N3O2S2
Molecular Weight: 449.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1csc(CCNc2cnc(Oc3ccc4c(c3)CCC(c3ccccc3)O4)s2)n1
Standard InChI: InChI=1S/C24H23N3O2S2/c1-16-15-30-22(27-16)11-12-25-23-14-26-24(31-23)28-19-8-10-21-18(13-19)7-9-20(29-21)17-5-3-2-4-6-17/h2-6,8,10,13-15,20,25H,7,9,11-12H2,1H3
Standard InChI Key: IPFOMQCQTLNHPJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
-5.9974 -5.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1113 -6.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2785 -7.8662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9124 -8.4859 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.9227 -7.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4309 -7.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5420 -6.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9498 -6.4949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8372 -5.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3372 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 -3.8679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1968 1.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4995 3.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7974 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7950 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4948 0.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 -3.8595 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6419 -6.0739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 17 1 0
22 23 2 0
23 14 1 0
19 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
12 30 1 0
30 9 1 0
5 31 2 0
31 2 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.60Molecular Weight (Monoisotopic): 449.1232AlogP: 6.42#Rotatable Bonds: 7Polar Surface Area: 56.27Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.21CX LogP: 5.39CX LogD: 5.39Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.35Np Likeness Score: -0.73
References 1. (2014) Substituted 2-(chroman-6-yloxy)-thiazoles and their use as pharmaceuticals,