The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-[(S)-4-((R)-2-Mercapto-3-phenyl-propionylamino)-3-oxo-1,3,4,5-tetrahydro-benzo[c]azepin-2-yl]-4-methyl-pentanoic acid ID: ALA366495
PubChem CID: 9825199
Max Phase: Preclinical
Molecular Formula: C25H30N2O4S
Molecular Weight: 454.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: MDL-100407 | CHEMBL366495|MDL-100407|BDBM50289194|(S)-2-[(S)-4-((R)-2-Mercapto-3-phenyl-propionylamino)-3-oxo-1,3,4,5-tetrahydro-benzo[c]azepin-2-yl]-4-methyl-pentanoic acid
Canonical SMILES: CC(C)C[C@@H](C(=O)O)N1Cc2ccccc2C[C@H](NC(=O)[C@H](S)Cc2ccccc2)C1=O
Standard InChI: InChI=1S/C25H30N2O4S/c1-16(2)12-21(25(30)31)27-15-19-11-7-6-10-18(19)14-20(24(27)29)26-23(28)22(32)13-17-8-4-3-5-9-17/h3-11,16,20-22,32H,12-15H2,1-2H3,(H,26,28)(H,30,31)/t20-,21-,22+/m0/s1
Standard InChI Key: MVSZLSBZJCTXKA-FDFHNCONSA-N
Molfile:
RDKit 2D
33 35 0 0 1 0 0 0 0 0999 V2000
6.9167 -3.6167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2042 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5250 -3.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7125 -3.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3125 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8167 -3.6042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1042 -3.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2875 -3.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -2.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9375 -2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0667 -1.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3917 -3.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0042 -4.5042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4917 -4.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1167 -2.3750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0667 -2.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6917 -3.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3917 -4.4042 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.0750 -3.4500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9750 -3.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7125 -4.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5250 -1.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8125 -1.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -4.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2667 -3.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5042 -5.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1292 -5.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3917 -0.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2667 -0.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5542 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -4.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5542 -4.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9167 -4.6125 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 1 1 0
5 1 1 0
3 6 1 1
7 6 1 0
8 4 1 0
9 3 1 0
10 5 1 0
11 10 2 0
12 7 1 0
13 2 2 0
4 14 1 6
15 7 2 0
16 8 2 0
17 12 1 0
12 18 1 6
19 8 1 0
20 17 1 0
21 14 1 0
22 10 1 0
23 11 1 0
24 20 2 0
25 20 1 0
26 21 1 0
27 21 1 0
28 29 1 0
29 22 2 0
30 25 2 0
31 24 1 0
32 30 1 0
4 33 1 1
11 9 1 0
28 23 2 0
31 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.59Molecular Weight (Monoisotopic): 454.1926AlogP: 3.10#Rotatable Bonds: 8Polar Surface Area: 86.71Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.95CX Basic pKa: ┄CX LogP: 4.04CX LogD: 0.85Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -0.17
References 1. Warshawsky AM, Flynn GA, Koehl JR, Mehdi S, Vaz RJ. (1996) The synthesis of aminobenzazepinones as anti-phenylalanine dipeptide mimics and their use in nep inhibition, 6 (8): [10.1016/0960-894X(96)00149-7 ]