US8785477, 1

ID: ALA3665962

PubChem CID: 76167485

Max Phase: Preclinical

Molecular Formula: C17H22F3N3O

Molecular Weight: 341.38

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CC2CCN(C(=O)CC(N)Cc3cc(F)c(F)cc3F)C2C1

Standard InChI:  InChI=1S/C17H22F3N3O/c1-22-8-10-2-3-23(16(10)9-22)17(24)6-12(21)4-11-5-14(19)15(20)7-13(11)18/h5,7,10,12,16H,2-4,6,8-9,21H2,1H3

Standard InChI Key:  CHZLSTXMQWLTDD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    1.4553   -2.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.0323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4623    2.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9623    2.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4258    1.2743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8515    0.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1024   -0.3599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9659    1.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3940    1.3573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6449    0.1838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5084    2.3626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9364    1.9010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2477    0.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6741   -0.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.9230   -1.2045    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7893    0.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9304    0.6013    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4781    2.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.0517    2.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8028    4.0781    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  8  9  1  0
  9  2  1  0
  7 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 23 16  1  0
 23 24  1  0
M  END

Associated Targets(non-human)

Dpp4 Dipeptidyl peptidase IV (407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 341.38Molecular Weight (Monoisotopic): 341.1715AlogP: 1.53#Rotatable Bonds: 4
Polar Surface Area: 49.57Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.99CX LogP: 1.20CX LogD: -1.37
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.85Np Likeness Score: -0.58

References

1.  (2014)  Hexahydropyrrolo[3,4-b]pyrrole derivatives, preparation methods and pharmaceutical uses thereof, 

Source

Source(1):