The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8785477, 8 ID: ALA3665964
PubChem CID: 76167613
Max Phase: Preclinical
Molecular Formula: C20H25F4N3O2
Molecular Weight: 415.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(F)C(=O)N1CC2CCN(C(=O)CC(N)Cc3cc(F)c(F)cc3F)C2C1
Standard InChI: InChI=1S/C20H25F4N3O2/c1-20(2,24)19(29)26-9-11-3-4-27(17(11)10-26)18(28)7-13(25)5-12-6-15(22)16(23)8-14(12)21/h6,8,11,13,17H,3-5,7,9-10,25H2,1-2H3
Standard InChI Key: HQQONCVLYGCKBV-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
-0.1779 -3.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0157 -3.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5255 -4.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7191 -4.5887 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.6281 -2.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8218 -2.1229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4623 2.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9623 2.7008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4258 1.2743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8515 0.8135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1024 -0.3599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9659 1.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3940 1.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6449 0.1838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.5084 2.3626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9364 1.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2477 0.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6741 -0.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9230 -1.2045 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-11.7893 0.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9304 0.6013 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-11.4781 2.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0517 2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8028 4.0781 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 2 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
13 14 1 0
14 7 1 0
12 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
23 25 2 0
25 26 1 0
25 27 1 0
27 28 2 0
28 21 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.43Molecular Weight (Monoisotopic): 415.1883AlogP: 2.17#Rotatable Bonds: 5Polar Surface Area: 66.64Molecular Species: BASEHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.78CX LogP: 1.51CX LogD: 0.11Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: -0.76
References 1. (2014) Hexahydropyrrolo[3,4-b]pyrrole derivatives, preparation methods and pharmaceutical uses thereof,