The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8785477, 17 ID: ALA3665966
PubChem CID: 76167811
Max Phase: Preclinical
Molecular Formula: C21H23F3N4O2
Molecular Weight: 420.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#CC1(C(=O)N2CC3CCN(C(=O)CC(N)Cc4cc(F)c(F)cc4F)C3C2)CC1
Standard InChI: InChI=1S/C21H23F3N4O2/c22-15-8-17(24)16(23)6-13(15)5-14(26)7-19(29)28-4-1-12-9-27(10-18(12)28)20(30)21(11-25)2-3-21/h6,8,12,14,18H,1-5,7,9-10,26H2
Standard InChI Key: NDMMXUDYKKQNKW-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
3.5241 -4.3930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0102 -3.2959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1255 -2.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6332 -2.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1470 -3.3397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7115 0.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1750 -1.0317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9615 -1.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5990 -1.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4922 -0.6962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9089 -2.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5403 -3.1866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5422 -4.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3358 -3.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4764 -3.8054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5026 -3.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3873 -4.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7773 -5.7196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6590 -6.9331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1710 -8.0294 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.1508 -6.7763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8562 -7.7470 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.7608 -5.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8791 -4.1924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3672 -3.0962 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 6 1 0
13 9 1 0
11 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 16 1 0
16 19 1 0
19 20 3 0
2 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
24 26 2 0
26 27 1 0
26 28 1 0
28 29 2 0
29 22 1 0
29 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.44Molecular Weight (Monoisotopic): 420.1773AlogP: 1.73#Rotatable Bonds: 5Polar Surface Area: 90.43Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.78CX LogP: 1.02CX LogD: -0.38Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.73Np Likeness Score: -0.83
References 1. (2014) Hexahydropyrrolo[3,4-b]pyrrole derivatives, preparation methods and pharmaceutical uses thereof,