US8785477, 17

ID: ALA3665966

PubChem CID: 76167811

Max Phase: Preclinical

Molecular Formula: C21H23F3N4O2

Molecular Weight: 420.44

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#CC1(C(=O)N2CC3CCN(C(=O)CC(N)Cc4cc(F)c(F)cc4F)C3C2)CC1

Standard InChI:  InChI=1S/C21H23F3N4O2/c22-15-8-17(24)16(23)6-13(15)5-14(26)7-19(29)28-4-1-12-9-27(10-18(12)28)20(30)21(11-25)2-3-21/h6,8,12,14,18H,1-5,7,9-10,26H2

Standard InChI Key:  NDMMXUDYKKQNKW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    3.5241   -4.3930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0102   -3.2959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1255   -2.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6332   -2.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1470   -3.3397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.0323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7115    0.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1750   -1.0317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9615   -1.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5990   -1.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4922   -0.6962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9089   -2.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5403   -3.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5422   -4.3030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3358   -3.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4764   -3.8054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5026   -3.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3873   -4.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7773   -5.7196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6590   -6.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1710   -8.0294    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.1508   -6.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8562   -7.7470    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.7608   -5.4059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8791   -4.1924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3672   -3.0962    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  6  1  0
 13  9  1  0
 11 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 16  1  0
 16 19  1  0
 19 20  3  0
  2 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 26 27  1  0
 26 28  1  0
 28 29  2  0
 29 22  1  0
 29 30  1  0
M  END

Associated Targets(non-human)

Dpp4 Dipeptidyl peptidase IV (407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.44Molecular Weight (Monoisotopic): 420.1773AlogP: 1.73#Rotatable Bonds: 5
Polar Surface Area: 90.43Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.78CX LogP: 1.02CX LogD: -0.38
Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.73Np Likeness Score: -0.83

References

1.  (2014)  Hexahydropyrrolo[3,4-b]pyrrole derivatives, preparation methods and pharmaceutical uses thereof, 

Source

Source(1):