The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8785477, 20 ID: ALA3665967
PubChem CID: 76167885
Max Phase: Preclinical
Molecular Formula: C21H28F3N3O2
Molecular Weight: 411.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)C(=O)N1CC2CCN(C(=O)CC(N)Cc3cc(F)c(F)cc3F)C2C1
Standard InChI: InChI=1S/C21H28F3N3O2/c1-21(2,3)20(29)26-10-12-4-5-27(18(12)11-26)19(28)8-14(25)6-13-7-16(23)17(24)9-15(13)22/h7,9,12,14,18H,4-6,8,10-11,25H2,1-3H3
Standard InChI Key: FAWFCXIXFONRRV-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
1.7191 -4.5887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0157 -3.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1779 -3.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5255 -4.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6281 -2.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8218 -2.1229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4623 2.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9623 2.7008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4258 1.2743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8515 0.8135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1024 -0.3599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9659 1.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3940 1.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6449 0.1838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.5084 2.3626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9364 1.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2477 0.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6741 -0.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9230 -1.2045 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-11.7893 0.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9304 0.6013 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-11.4781 2.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0517 2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8028 4.0781 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 2 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
13 14 1 0
14 7 1 0
12 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
23 25 2 0
25 26 1 0
25 27 1 0
27 28 2 0
28 21 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 411.47Molecular Weight (Monoisotopic): 411.2134AlogP: 2.47#Rotatable Bonds: 4Polar Surface Area: 66.64Molecular Species: BASEHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.78CX LogP: 2.23CX LogD: 0.84Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.77Np Likeness Score: -0.93
References 1. (2014) Hexahydropyrrolo[3,4-b]pyrrole derivatives, preparation methods and pharmaceutical uses thereof,