The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8785477, 26 ID: ALA3665968
PubChem CID: 76167959
Max Phase: Preclinical
Molecular Formula: C24H26F3N3O4S
Molecular Weight: 509.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)c1cccc(C(=O)N2CC3CCN(C(=O)CC(N)Cc4cc(F)c(F)cc4F)C3C2)c1
Standard InChI: InChI=1S/C24H26F3N3O4S/c1-35(33,34)18-4-2-3-14(8-18)24(32)29-12-15-5-6-30(22(15)13-29)23(31)10-17(28)7-16-9-20(26)21(27)11-19(16)25/h2-4,8-9,11,15,17,22H,5-7,10,12-13,28H2,1H3
Standard InChI Key: USIYDIOPKBFAMU-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-3.2863 -4.3145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5847 -5.2880 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.0772 -6.3822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7786 -5.4087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0915 -5.1363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2141 -6.3529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2783 -6.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8931 -4.8331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0157 -3.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4767 -3.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6281 -2.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8218 -2.1229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4623 2.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9623 2.7008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4258 1.2743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8515 0.8135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1024 -0.3599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9659 1.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3940 1.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6449 0.1838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.5084 2.3626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9364 1.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2477 0.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6741 -0.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9230 -1.2045 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-11.7893 0.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9304 0.6013 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-11.4781 2.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0517 2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8028 4.0781 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 2 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
9 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
19 20 1 0
20 13 1 0
18 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
24 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
29 31 2 0
31 32 1 0
31 33 1 0
33 34 2 0
34 27 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.55Molecular Weight (Monoisotopic): 509.1596AlogP: 2.14#Rotatable Bonds: 6Polar Surface Area: 100.78Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.78CX LogP: 1.12CX LogD: -0.27Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.60Np Likeness Score: -1.35
References 1. (2014) Hexahydropyrrolo[3,4-b]pyrrole derivatives, preparation methods and pharmaceutical uses thereof,