US8785477, 26

ID: ALA3665968

PubChem CID: 76167959

Max Phase: Preclinical

Molecular Formula: C24H26F3N3O4S

Molecular Weight: 509.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)c1cccc(C(=O)N2CC3CCN(C(=O)CC(N)Cc4cc(F)c(F)cc4F)C3C2)c1

Standard InChI:  InChI=1S/C24H26F3N3O4S/c1-35(33,34)18-4-2-3-14(8-18)24(32)29-12-15-5-6-30(22(15)13-29)23(31)10-17(28)7-16-9-20(26)21(27)11-19(16)25/h2-4,8-9,11,15,17,22H,5-7,10,12-13,28H2,1H3

Standard InChI Key:  USIYDIOPKBFAMU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -3.2863   -4.3145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5847   -5.2880    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0772   -6.3822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7786   -5.4087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0915   -5.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2141   -6.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2783   -6.2013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8931   -4.8331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0157   -3.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4767   -3.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6281   -2.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8218   -2.1229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.0323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4623    2.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9623    2.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4258    1.2743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8515    0.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1024   -0.3599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9659    1.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3940    1.3573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6449    0.1838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5084    2.3626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9364    1.9010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2477    0.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6741   -0.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.9230   -1.2045    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7893    0.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9304    0.6013    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4781    2.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.0517    2.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8028    4.0781    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  2  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  9 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 19 20  1  0
 20 13  1  0
 18 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 31 33  1  0
 33 34  2  0
 34 27  1  0
 34 35  1  0
M  END

Associated Targets(non-human)

Dpp4 Dipeptidyl peptidase IV (407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.55Molecular Weight (Monoisotopic): 509.1596AlogP: 2.14#Rotatable Bonds: 6
Polar Surface Area: 100.78Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.78CX LogP: 1.12CX LogD: -0.27
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.60Np Likeness Score: -1.35

References

1.  (2014)  Hexahydropyrrolo[3,4-b]pyrrole derivatives, preparation methods and pharmaceutical uses thereof, 

Source

Source(1):