US8822447, 172

ID: ALA3666184

PubChem CID: 86767159

Max Phase: Preclinical

Molecular Formula: C26H26N4OS

Molecular Weight: 442.59

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CSc1nn(-c2ccccc2)c2cc(NC(=O)C3(c4ccccc4)CCNCC3)ccc12

Standard InChI:  InChI=1S/C26H26N4OS/c1-32-24-22-13-12-20(18-23(22)30(29-24)21-10-6-3-7-11-21)28-25(31)26(14-16-27-17-15-26)19-8-4-2-5-9-19/h2-13,18,27H,14-17H2,1H3,(H,28,31)

Standard InChI Key:  IDGMLULWSFTSPU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   -0.3167   -5.2226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6890   -4.0818    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8813   -1.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9619   -2.4739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4015   -2.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7561   -0.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6713    0.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2318    0.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3421    3.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070    5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3459    6.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0483    7.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2521    6.7342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2550    5.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0426    4.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6084    5.9986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9062    5.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2065    5.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2091    7.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9114    8.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6110    7.4986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  5 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 18  1  0
 18 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 14 30  2  0
 30 31  1  0
 31 32  2  0
 32  3  1  0
 32 12  1  0
M  END

Associated Targets(Human)

KHK Tchem Ketohexokinase (328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.59Molecular Weight (Monoisotopic): 442.1827AlogP: 5.01#Rotatable Bonds: 5
Polar Surface Area: 58.95Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.25CX Basic pKa: 9.84CX LogP: 5.33CX LogD: 2.96
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -1.13

References

1.  (2014)  Indazole compounds useful as ketohexokinase inhibitors, 

Source

Source(1):