The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8822447, 172 ID: ALA3666184
PubChem CID: 86767159
Max Phase: Preclinical
Molecular Formula: C26H26N4OS
Molecular Weight: 442.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CSc1nn(-c2ccccc2)c2cc(NC(=O)C3(c4ccccc4)CCNCC3)ccc12
Standard InChI: InChI=1S/C26H26N4OS/c1-32-24-22-13-12-20(18-23(22)30(29-24)21-10-6-3-7-11-21)28-25(31)26(14-16-27-17-15-26)19-8-4-2-5-9-19/h2-13,18,27H,14-17H2,1H3,(H,28,31)
Standard InChI Key: IDGMLULWSFTSPU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-0.3167 -5.2226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6890 -4.0818 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8813 -1.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9619 -2.4739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4015 -2.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7561 -0.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6713 0.4410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2318 0.0194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3421 3.1476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3459 6.7293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0483 7.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2521 6.7342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2550 5.2342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0426 4.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6084 5.9986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9062 5.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2065 5.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2091 7.4940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9114 8.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6110 7.4986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
5 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 18 1 0
18 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
14 30 2 0
30 31 1 0
31 32 2 0
32 3 1 0
32 12 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.59Molecular Weight (Monoisotopic): 442.1827AlogP: 5.01#Rotatable Bonds: 5Polar Surface Area: 58.95Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.25CX Basic pKa: 9.84CX LogP: 5.33CX LogD: 2.96Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -1.13
References 1. (2014) Indazole compounds useful as ketohexokinase inhibitors,