The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8685992, 14 ID: ALA3670668
PubChem CID: 51038885
Max Phase: Preclinical
Molecular Formula: C28H27N3O3S
Molecular Weight: 485.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc(-c3ccccc3)[nH]c2C(=O)NCc2ccc(C(=O)NCCS)cc2)cc1
Standard InChI: InChI=1S/C28H27N3O3S/c1-34-23-13-11-20(12-14-23)24-17-25(21-5-3-2-4-6-21)31-26(24)28(33)30-18-19-7-9-22(10-8-19)27(32)29-15-16-35/h2-14,17,31,35H,15-16,18H2,1H3,(H,29,32)(H,30,33)
Standard InChI Key: BUXPYIKGVMPYJG-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
2.5956 -2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9492 0.8772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9546 1.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2067 3.2905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7390 2.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6216 3.9790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4820 3.6032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9268 5.4485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8074 6.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1126 7.9177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 8.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3032 10.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7286 10.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8460 9.8531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5380 8.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0398 12.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1473 13.1243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4666 12.7876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7778 14.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2046 14.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4534 15.8953 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-6.4469 1.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1532 0.5134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.6524 0.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.4423 1.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7329 3.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2337 3.1102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
6 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 9 2 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
11 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.61Molecular Weight (Monoisotopic): 485.1773AlogP: 4.95#Rotatable Bonds: 9Polar Surface Area: 83.22Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.07CX Basic pKa: ┄CX LogP: 4.31CX LogD: 4.31Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.25Np Likeness Score: -0.79
References 1. (2014) Histone deacetylase inhibitors based simultaneously on trisubstituted 1H-pyrroles and aromatic and heteroaromatic spacers,