The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8785638, 160 ID: ALA3670998
PubChem CID: 49805118
Max Phase: Preclinical
Molecular Formula: C25H29NO3S
Molecular Weight: 423.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(C(=O)O)c1c(C)nc2sc3c(c2c1-c1ccc(C)cc1OC)CCCC3
Standard InChI: InChI=1S/C25H29NO3S/c1-5-8-18(25(27)28)21-15(3)26-24-23(17-9-6-7-10-20(17)30-24)22(21)16-12-11-14(2)13-19(16)29-4/h11-13,18H,5-10H2,1-4H3,(H,27,28)
Standard InChI Key: ZHIWDLNGUFACHB-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
3.8916 -4.9570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8999 -0.7576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9372 -1.3609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9040 0.4424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0972 -0.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7073 -1.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8256 -2.7399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3339 -2.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 -6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0067 -7.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6004 -3.0073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6378 -3.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
5 7 1 0
4 8 1 0
8 9 2 0
9 10 1 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 14 2 0
19 20 1 0
20 12 1 0
20 21 2 0
21 8 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
25 27 1 0
27 28 2 0
28 22 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.58Molecular Weight (Monoisotopic): 423.1868AlogP: 6.44#Rotatable Bonds: 6Polar Surface Area: 59.42Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.13CX Basic pKa: 2.50CX LogP: 6.79CX LogD: 4.54Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.50Np Likeness Score: -0.90
References 1. (2014) Thieno [2, 3-B] pyridine derivatives as viral replication inhibitors,