The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8785638, 163 ID: ALA3671001
PubChem CID: 49805248
Max Phase: Preclinical
Molecular Formula: C30H32N2O2S
Molecular Weight: 484.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(C(=O)O)c1c(C)nc2sc3c(c2c1-c1ccc(C)cc1)CCN(Cc1ccccc1)C3
Standard InChI: InChI=1S/C30H32N2O2S/c1-4-8-24(30(33)34)26-20(3)31-29-28(27(26)22-13-11-19(2)12-14-22)23-15-16-32(18-25(23)35-29)17-21-9-6-5-7-10-21/h5-7,9-14,24H,4,8,15-18H2,1-3H3,(H,33,34)
Standard InChI Key: YTAYGQUCXMWKDX-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
3.8916 -4.9570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8999 -0.7576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9372 -1.3609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9040 0.4424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0972 -0.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7073 -1.5264 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.1996 -1.6864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8081 -3.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2993 -3.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.9047 -4.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0188 -5.8033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5276 -5.6413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9222 -4.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8256 -2.7399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3339 -2.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 -6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0067 -7.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
5 7 1 0
4 8 1 0
8 9 2 0
9 10 1 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
16 24 1 0
24 25 1 0
25 26 1 0
26 14 2 0
26 27 1 0
27 12 1 0
27 28 2 0
28 8 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
32 34 1 0
34 35 2 0
35 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.67Molecular Weight (Monoisotopic): 484.2184AlogP: 7.11#Rotatable Bonds: 7Polar Surface Area: 53.43Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.75CX Basic pKa: 7.09CX LogP: 4.96CX LogD: 4.57Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -1.08
References 1. (2014) Thieno [2, 3-B] pyridine derivatives as viral replication inhibitors,