US8785638, 165

ID: ALA3671002

PubChem CID: 49805250

Max Phase: Preclinical

Molecular Formula: C25H27NO2S

Molecular Weight: 405.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2c(C(CC3CC3)C(=O)O)c(C)nc3sc4c(c23)CCCC4)cc1

Standard InChI:  InChI=1S/C25H27NO2S/c1-14-7-11-17(12-8-14)22-21(19(25(27)28)13-16-9-10-16)15(2)26-24-23(22)18-5-3-4-6-20(18)29-24/h7-8,11-12,16,19H,3-6,9-10,13H2,1-2H3,(H,27,28)

Standard InChI Key:  YFHZZJZFHCSGMJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    6.2328   -3.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5972    1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951    3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933    3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5642    5.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3141    3.7112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8999    0.7576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9372    1.3609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9040   -0.4424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133   -1.7530    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4134   -4.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5318   -5.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0400   -5.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5701   -4.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 12  1  0
 10 15  1  0
 15 16  2  0
 15 17  1  0
  9 18  1  0
 18 19  1  0
 18 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 23  2  0
 28 29  1  0
 29  8  1  0
 29 21  2  0
M  END

Associated Targets(non-human)

gag-pol Gag-Pol polyprotein (85 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 405.56Molecular Weight (Monoisotopic): 405.1763AlogP: 6.43#Rotatable Bonds: 5
Polar Surface Area: 50.19Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.23CX Basic pKa: 2.91CX LogP: 6.77CX LogD: 4.61
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: -0.90

References

1.  (2014)  Thieno [2, 3-B] pyridine derivatives as viral replication inhibitors, 

Source

Source(1):