US8785638, 182

ID: ALA3671011

PubChem CID: 71590239

Max Phase: Preclinical

Molecular Formula: C26H28N2O2S2

Molecular Weight: 464.66

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(c1c(C)nc2sc3c(c2c1-c1ccc(C)cc1)CCCC3)C1SC(=O)NC1=O

Standard InChI:  InChI=1S/C26H28N2O2S2/c1-4-7-18(23-24(29)28-26(30)32-23)20-15(3)27-25-22(17-8-5-6-9-19(17)31-25)21(20)16-12-10-14(2)11-13-16/h10-13,18,23H,4-9H2,1-3H3,(H,28,29,30)

Standard InChI Key:  HTWXWRNUDPWWLL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    1.2922   -4.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2948   -3.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5957   -3.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5990   -1.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2484   -1.3759    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.2557   -0.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4487   -0.3938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5100    1.0370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0418    0.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1478    1.5305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3383    1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248    1.2135    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6065    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0972   -0.1561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7073   -1.5264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8256   -2.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3339   -2.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248   -1.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2978   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2955   -5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0048   -6.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0067   -7.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3026   -5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3002   -3.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10  5  1  0
 10 11  2  0
  4 12  1  0
 12 13  2  0
 13 14  1  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 18  2  0
 23 24  1  0
 24 16  1  0
 24 25  2  0
 25 12  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 29 31  1  0
 31 32  2  0
 32 26  1  0
M  END

Associated Targets(non-human)

gag-pol Gag-Pol polyprotein (85 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 464.66Molecular Weight (Monoisotopic): 464.1592AlogP: 6.69#Rotatable Bonds: 5
Polar Surface Area: 59.06Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.61CX Basic pKa: 2.95CX LogP: 7.10CX LogD: 6.28
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -0.93

References

1.  (2014)  Thieno [2, 3-B] pyridine derivatives as viral replication inhibitors, 

Source

Source(1):