The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8785638, 184 ID: ALA3671012
Cas Number: 1256256-55-9
PubChem CID: 49806338
Max Phase: Preclinical
Molecular Formula: C24H28N2O3S
Molecular Weight: 424.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2c(C(OC(C)(C)C)C(=O)O)c(C)nc3sc4c(c23)CCCC4)cn1
Standard InChI: InChI=1S/C24H28N2O3S/c1-13-10-11-15(12-25-13)19-18(21(23(27)28)29-24(3,4)5)14(2)26-22-20(19)16-8-6-7-9-17(16)30-22/h10-12,21H,6-9H2,1-5H3,(H,27,28)
Standard InChI Key: ZPVZMJDEABMWMW-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
6.2328 -3.6062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8916 4.9570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 3.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9316 4.3587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8999 0.7576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9372 1.3609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9040 -0.4424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4133 -1.7530 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4134 -4.4924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5318 -5.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0400 -5.5491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5701 -4.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
5 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 1 0
12 15 1 0
10 16 1 0
16 17 2 0
16 18 1 0
9 19 1 0
19 20 1 0
19 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 24 2 0
29 30 1 0
30 8 1 0
30 22 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.57Molecular Weight (Monoisotopic): 424.1821AlogP: 5.79#Rotatable Bonds: 4Polar Surface Area: 72.31Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.48CX Basic pKa: 5.36CX LogP: 3.92CX LogD: 2.17Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.57Np Likeness Score: -1.14
References 1. (2014) Thieno [2, 3-B] pyridine derivatives as viral replication inhibitors,