The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8785638, 186 ID: ALA3671013
PubChem CID: 49806339
Max Phase: Preclinical
Molecular Formula: C25H26N2O3S2
Molecular Weight: 466.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc2sc3c(c2c(-c2ccc4ncsc4c2)c1C(OC(C)(C)C)C(=O)O)CCCC3
Standard InChI: InChI=1S/C25H26N2O3S2/c1-13-19(22(24(28)29)30-25(2,3)4)20(14-9-10-16-18(11-14)31-12-26-16)21-15-7-5-6-8-17(15)32-23(21)27-13/h9-12,22H,5-8H2,1-4H3,(H,28,29)
Standard InChI Key: CUSOWJKXNBLJSG-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
2.3383 -1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3115 2.9665 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.8032 3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6838 4.3363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1756 4.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7857 2.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9040 1.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4133 1.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 -1.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1945 -3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3072 -4.0093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.6949 -5.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2034 -5.2195 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5964 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.7494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3471 -5.8487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2688 -5.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3089 -6.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2938 -3.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2900 -4.9562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3351 -3.1598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 6 2 0
11 12 1 0
12 4 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 17 1 0
21 22 2 0
22 14 1 0
13 23 2 0
23 2 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
24 30 1 0
30 31 2 0
30 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.63Molecular Weight (Monoisotopic): 466.1385AlogP: 6.70#Rotatable Bonds: 4Polar Surface Area: 72.31Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.47CX Basic pKa: 2.75CX LogP: 5.96CX LogD: 3.27Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.23
References 1. (2014) Thieno [2, 3-B] pyridine derivatives as viral replication inhibitors,