The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8785638, 190 ID: ALA3671015
PubChem CID: 49806579
Max Phase: Preclinical
Molecular Formula: C29H30N2O4S
Molecular Weight: 502.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc2sc3c(c2c(-c2ccc4c5c(ccnc25)CCO4)c1C(OC(C)(C)C)C(=O)O)CCCC3
Standard InChI: InChI=1S/C29H30N2O4S/c1-15-21(26(28(32)33)35-29(2,3)4)23(24-17-7-5-6-8-20(17)36-27(24)31-15)18-9-10-19-22-16(12-14-34-19)11-13-30-25(18)22/h9-11,13,26H,5-8,12,14H2,1-4H3,(H,32,33)
Standard InChI Key: WATCBOSILHMOJC-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
2.3383 -1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3115 2.9665 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.8032 3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6838 4.3363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1756 4.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7857 2.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9040 1.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4133 1.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5964 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1945 -3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4924 -3.7566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7926 -3.0087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7950 -1.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 -0.7566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4995 0.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2017 1.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9014 0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 -1.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.7494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3471 -5.8487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2688 -5.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3089 -6.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2938 -3.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2900 -4.9562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3351 -3.1598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 6 2 0
11 12 1 0
12 4 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 14 1 0
25 26 2 0
26 17 1 0
26 21 1 0
13 27 2 0
27 2 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
28 34 1 0
34 35 2 0
34 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.64Molecular Weight (Monoisotopic): 502.1926AlogP: 6.57#Rotatable Bonds: 4Polar Surface Area: 81.54Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.31CX Basic pKa: 5.01CX LogP: 5.16CX LogD: 3.19Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: -0.79
References 1. (2014) Thieno [2, 3-B] pyridine derivatives as viral replication inhibitors,