The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8987314, B63 ID: ALA3672653
PubChem CID: 89969715
Max Phase: Preclinical
Molecular Formula: C20H23N3O6S3
Molecular Weight: 497.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCc1ccc(-c2ccc3nc(C(C(=O)NCCS(N)(=O)=O)S(C)(=O)=O)sc3c2)cc1
Standard InChI: InChI=1S/C20H23N3O6S3/c1-29-12-13-3-5-14(6-4-13)15-7-8-16-17(11-15)30-20(23-16)18(31(2,25)26)19(24)22-9-10-32(21,27)28/h3-8,11,18H,9-10,12H2,1-2H3,(H,22,24)(H2,21,27,28)
Standard InChI Key: LRHPOJWPSLDDRC-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
7.5241 -5.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4870 -5.2605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1047 -0.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8532 -1.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2514 -2.3421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.3541 -1.3071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.1026 -2.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6034 -2.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3519 -3.9119 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-11.5519 -3.9144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.9499 -4.9523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.7501 -4.9501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.8601 1.2937 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-7.0601 1.2899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4636 2.3310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2637 2.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 13 1 0
17 18 2 0
18 10 1 0
15 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
25 27 2 0
25 28 1 0
19 29 1 0
29 30 2 0
29 31 2 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.62Molecular Weight (Monoisotopic): 497.0749AlogP: 1.60#Rotatable Bonds: 9Polar Surface Area: 145.52Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.48CX Basic pKa: ┄CX LogP: 0.47CX LogD: 0.21Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -1.29
References 1. (2015) Amide, urea or sulfone amide linked benzothiazole inhibitors of endothelial lipase,