The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9045524, 16 ID: ALA3673255
PubChem CID: 44520371
Max Phase: Preclinical
Molecular Formula: C29H37N3O8
Molecular Weight: 555.63
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)OC(C)(C)C)NC(=O)OCc1ccccc1)c1ccccc1)C(=O)O
Standard InChI: InChI=1S/C29H37N3O8/c1-18(2)23(27(36)37)31-26(35)24(20-14-10-7-11-15-20)32-25(34)21(16-22(33)40-29(3,4)5)30-28(38)39-17-19-12-8-6-9-13-19/h6-15,18,21,23-24H,16-17H2,1-5H3,(H,30,38)(H,31,35)(H,32,34)(H,36,37)/t21-,23-,24-/m0/s1
Standard InChI Key: TWWZUCMYONWXDC-XWGVYQGASA-N
Molfile:
RDKit 2D
40 41 0 0 1 0 0 0 0 0999 V2000
3.6166 -12.6050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5786 -12.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5384 -12.6011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5808 -10.5021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8834 -9.7566 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1807 -10.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1766 -11.7111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1470 -8.1099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4889 -5.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4894 -3.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4502 -3.1592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7889 -3.0084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7894 -1.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8284 -0.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7502 -0.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7892 -0.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7815 -10.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7816 -12.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0806 -12.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3797 -12.0188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3797 -10.5188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0807 -9.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2834 -9.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2419 -10.3436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2876 -8.5475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 1
5 6 1 0
6 7 2 0
6 8 1 0
8 9 1 1
9 10 1 0
10 11 2 0
10 12 1 0
12 13 1 1
13 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
17 19 1 0
17 20 1 0
12 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
8 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
4 38 1 0
38 39 2 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.63Molecular Weight (Monoisotopic): 555.2581AlogP: 3.10#Rotatable Bonds: 12Polar Surface Area: 160.13Molecular Species: ACIDHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.91CX Basic pKa: ┄CX LogP: 3.32CX LogD: 0.12Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.29Np Likeness Score: -0.24
References 1. (2015) Selective caspase inhibitors and uses thereof,