The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8691753, 37 ID: ALA3675541
PubChem CID: 84973136
Max Phase: Preclinical
Molecular Formula: C21H26N4O5S
Molecular Weight: 446.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](NC(=O)CCc1ccc(-c2nccs2)cc1)C(=O)N[C@@H](CCC(=O)O)C(N)=O
Standard InChI: InChI=1S/C21H26N4O5S/c1-2-15(20(30)25-16(19(22)29)8-10-18(27)28)24-17(26)9-5-13-3-6-14(7-4-13)21-23-11-12-31-21/h3-4,6-7,11-12,15-16H,2,5,8-10H2,1H3,(H2,22,29)(H,24,26)(H,25,30)(H,27,28)/t15-,16-/m0/s1
Standard InChI Key: RESDGLIYQGGYGR-HOTGVXAUSA-N
Molfile:
RDKit 2D
31 32 0 0 1 0 0 0 0 0999 V2000
6.4893 -4.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4889 -5.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7390 2.9810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2067 3.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9546 1.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9492 0.8772 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1470 -8.1099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7815 -10.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7794 -12.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0776 -12.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0759 -13.9726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1179 -12.1744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1838 -10.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1834 -11.7165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1446 -9.9165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 1
3 4 1 0
4 5 1 0
5 6 2 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 1 0
3 20 1 0
20 21 2 0
20 22 1 0
23 22 1 1
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
26 28 1 0
23 29 1 0
29 30 2 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.53Molecular Weight (Monoisotopic): 446.1624AlogP: 1.47#Rotatable Bonds: 12Polar Surface Area: 151.48Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.13CX Basic pKa: 2.61CX LogP: 0.86CX LogD: -2.05Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.39Np Likeness Score: -0.59
References 1. (2014) Pseudodipeptides as MMP inhibitors,