The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8691753, 46 ID: ALA3675548
PubChem CID: 50992233
Max Phase: Preclinical
Molecular Formula: C29H31N3O6
Molecular Weight: 517.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCC(=O)O)NC(=O)CCc1ccc(-c2ccccc2)cc1
Standard InChI: InChI=1S/C29H31N3O6/c30-28(37)25(18-20-8-13-23(33)14-9-20)32-29(38)24(15-17-27(35)36)31-26(34)16-10-19-6-11-22(12-7-19)21-4-2-1-3-5-21/h1-9,11-14,24-25,33H,10,15-18H2,(H2,30,37)(H,31,34)(H,32,38)(H,35,36)/t24-,25-/m0/s1
Standard InChI Key: IIRLMDJELCRLPB-DQEYMECFSA-N
Molfile:
RDKit 2D
38 40 0 0 1 0 0 0 0 0999 V2000
0.2564 -3.1547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2956 -3.7547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2952 -4.9547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8509 -5.8560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4920 -5.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7894 -6.0199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0920 -5.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1293 -5.8778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0961 -4.0745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5257 -7.6666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7815 -10.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7794 -12.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0758 -12.7741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0706 -14.2741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7690 -15.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4726 -14.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4778 -12.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7638 -16.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0591 -17.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0515 -18.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7487 -19.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4535 -18.7639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4610 -17.2639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 6
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
9 11 1 0
11 12 2 0
12 6 1 0
4 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 1 6
17 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
16 22 1 0
22 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.58Molecular Weight (Monoisotopic): 517.2213AlogP: 2.55#Rotatable Bonds: 13Polar Surface Area: 158.82Molecular Species: ACIDHBA: 5HBD: 5#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.10CX Basic pKa: ┄CX LogP: 2.82CX LogD: -0.28Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.23Np Likeness Score: 0.05
References 1. (2014) Pseudodipeptides as MMP inhibitors,