The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8691753, 54 ID: ALA3675556
PubChem CID: 50992417
Max Phase: Preclinical
Molecular Formula: C25H29N3O8
Molecular Weight: 499.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CCc1ccc(-c2cccc(O)c2)cc1
Standard InChI: InChI=1S/C25H29N3O8/c26-24(35)19(9-12-22(31)32)28-25(36)20(10-13-23(33)34)27-21(30)11-6-15-4-7-16(8-5-15)17-2-1-3-18(29)14-17/h1-5,7-8,14,19-20,29H,6,9-13H2,(H2,26,35)(H,27,30)(H,28,36)(H,31,32)(H,33,34)/t19-,20-/m0/s1
Standard InChI Key: UIEDXQBYCVBGGE-PMACEKPBSA-N
Molfile:
RDKit 2D
36 37 0 0 1 0 0 0 0 0999 V2000
5.1766 -11.7111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1807 -10.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1434 -9.9078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7815 -10.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7794 -12.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0776 -12.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0759 -13.9726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1179 -12.1744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1470 -8.1099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4889 -5.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4894 -3.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7889 -3.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7893 -1.8084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8281 -3.6084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6012 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9015 3.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2352 0.8946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8967 0.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 1
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
4 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 1
14 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
13 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 1 0
34 36 2 0
36 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.52Molecular Weight (Monoisotopic): 499.1955AlogP: 1.18#Rotatable Bonds: 14Polar Surface Area: 196.12Molecular Species: ACIDHBA: 6HBD: 6#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.83CX Basic pKa: ┄CX LogP: 0.81CX LogD: -5.34Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.22Np Likeness Score: 0.07
References 1. (2014) Pseudodipeptides as MMP inhibitors,