The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8691753, 69 ID: ALA3675571
PubChem CID: 50991138
Max Phase: Preclinical
Molecular Formula: C32H37N3O5
Molecular Weight: 543.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)CCc1ccc(-c2ccc(-c3ccccc3)cc2)cc1)C(N)=O
Standard InChI: InChI=1S/C32H37N3O5/c1-21(2)20-28(31(33)39)35-32(40)27(17-19-30(37)38)34-29(36)18-10-22-8-11-24(12-9-22)26-15-13-25(14-16-26)23-6-4-3-5-7-23/h3-9,11-16,21,27-28H,10,17-20H2,1-2H3,(H2,33,39)(H,34,36)(H,35,40)(H,37,38)/t27-,28-/m0/s1
Standard InChI Key: CKYKLNXMCJIGPN-NSOVKSMOSA-N
Molfile:
RDKit 2D
40 42 0 0 1 0 0 0 0 0999 V2000
8.8174 -12.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7794 -12.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7391 -12.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7815 -10.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1470 -8.1099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4889 -5.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4894 -3.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7889 -3.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7893 -1.8084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8281 -3.6084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6012 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9015 3.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8967 0.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5002 3.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5050 5.2446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8065 5.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1031 5.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0983 3.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7969 2.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1807 -10.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1434 -9.9078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1766 -11.7111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
5 4 1 1
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
9 10 1 1
10 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
9 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
5 38 1 0
38 39 2 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 543.66Molecular Weight (Monoisotopic): 543.2733AlogP: 4.32#Rotatable Bonds: 14Polar Surface Area: 138.59Molecular Species: ACIDHBA: 4HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.08CX Basic pKa: ┄CX LogP: 4.37CX LogD: 1.26Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.24Np Likeness Score: -0.03
References 1. (2014) Pseudodipeptides as MMP inhibitors,