The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8691753, 92 ID: ALA3675593
PubChem CID: 50991590
Max Phase: Preclinical
Molecular Formula: C29H31N3O7S
Molecular Weight: 565.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CCc1ccc(-c2ccc(-c3ccccc3)s2)cc1
Standard InChI: InChI=1S/C29H31N3O7S/c30-28(38)21(11-16-26(34)35)32-29(39)22(12-17-27(36)37)31-25(33)15-8-18-6-9-20(10-7-18)24-14-13-23(40-24)19-4-2-1-3-5-19/h1-7,9-10,13-14,21-22H,8,11-12,15-17H2,(H2,30,38)(H,31,33)(H,32,39)(H,34,35)(H,36,37)/t21-,22-/m0/s1
Standard InChI Key: QFGALMYSDQBVRH-VXKWHMMOSA-N
Molfile:
RDKit 2D
40 42 0 0 1 0 0 0 0 0999 V2000
5.1766 -11.7111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1807 -10.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1434 -9.9078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7815 -10.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7794 -12.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0776 -12.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0759 -13.9726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1179 -12.1744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1470 -8.1099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4889 -5.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4894 -3.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7889 -3.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7893 -1.8084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8281 -3.6084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7390 2.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2067 3.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9546 1.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9492 0.8772 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-6.4469 1.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4153 2.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8906 2.6991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.3937 1.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4213 0.1438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9460 0.4147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 1
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
4 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 1
14 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
13 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 30 1 0
33 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.65Molecular Weight (Monoisotopic): 565.1883AlogP: 3.20#Rotatable Bonds: 15Polar Surface Area: 175.89Molecular Species: ACIDHBA: 6HBD: 5#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.82CX Basic pKa: ┄CX LogP: 2.54CX LogD: -3.63Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.19Np Likeness Score: -0.17
References 1. (2014) Pseudodipeptides as MMP inhibitors,