The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8691753, 101 ID: ALA3675599
PubChem CID: 69922083
Max Phase: Preclinical
Molecular Formula: C28H29N3O7S
Molecular Weight: 551.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CCc1ccc(-c2cc(-c3ccccc3)cs2)cc1
Standard InChI: InChI=1S/C28H29N3O7S/c29-27(37)22(15-26(35)36)31-28(38)21(11-13-25(33)34)30-24(32)12-8-17-6-9-19(10-7-17)23-14-20(16-39-23)18-4-2-1-3-5-18/h1-7,9-10,14,16,21-22H,8,11-13,15H2,(H2,29,37)(H,30,32)(H,31,38)(H,33,34)(H,35,36)/t21-,22-/m0/s1
Standard InChI Key: UUDTVMMARAFNKG-VXKWHMMOSA-N
Molfile:
RDKit 2D
39 41 0 0 1 0 0 0 0 0999 V2000
5.1766 -11.7111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1807 -10.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1434 -9.9078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7815 -10.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7794 -12.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8174 -12.6217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7391 -12.6177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1470 -8.1099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4889 -5.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4894 -3.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7889 -3.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7893 -1.8084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8281 -3.6084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7390 2.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2067 3.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9546 1.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9492 0.8772 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.8193 4.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0353 5.9336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7489 7.2530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2483 7.2947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0341 6.0170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3205 4.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 1
5 6 1 0
6 7 2 0
6 8 1 0
4 9 1 0
9 10 1 0
10 11 2 0
10 12 1 0
12 13 1 1
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
12 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 29 1 0
31 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 551.62Molecular Weight (Monoisotopic): 551.1726AlogP: 2.81#Rotatable Bonds: 14Polar Surface Area: 175.89Molecular Species: ACIDHBA: 6HBD: 5#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.59CX Basic pKa: ┄CX LogP: 2.25CX LogD: -4.09Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.20Np Likeness Score: -0.21
References 1. (2014) Pseudodipeptides as MMP inhibitors,