The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8829190, 117 ID: ALA3676246
PubChem CID: 25115266
Max Phase: Preclinical
Molecular Formula: C21H21Cl2N5O3
Molecular Weight: 462.34
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)Cc2c(Cl)cncc2Cl)n2nc(C3(C(=O)NC(C)C)CC3)nc12
Standard InChI: InChI=1S/C21H21Cl2N5O3/c1-11(2)25-20(30)21(6-7-21)19-26-18-17(31-3)5-4-15(28(18)27-19)16(29)8-12-13(22)9-24-10-14(12)23/h4-5,9-11H,6-8H2,1-3H3,(H,25,30)
Standard InChI Key: BSWGHDDDYLHRNH-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6375 0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8934 5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8542 5.8570 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.1924 6.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4915 5.2571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4915 3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1925 3.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1925 1.8070 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5502 -4.4225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7173 -3.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7147 -5.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7978 -5.7212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5978 -5.7190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5454 -7.0225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7930 -8.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3908 -9.3616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5930 -8.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
11 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 10 1 0
16 17 1 0
6 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 3 1 0
22 18 1 0
20 23 1 0
23 24 1 0
24 25 1 0
25 23 1 0
23 26 1 0
26 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.34Molecular Weight (Monoisotopic): 461.1021AlogP: 3.42#Rotatable Bonds: 7Polar Surface Area: 98.48Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.92CX Basic pKa: 1.50CX LogP: 3.34CX LogD: 3.34Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -0.83
References 1. (2014) Triazolopyridines as phosphodiesterase inhibitors for treatment of dermal diseases,