The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8987314, B87 ID: ALA3677433
PubChem CID: 89962259
Max Phase: Preclinical
Molecular Formula: C18H20N4O6S3
Molecular Weight: 484.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc3sc(C(C(=O)NCCS(N)(=O)=O)S(C)(=O)=O)nc3c2)cn1
Standard InChI: InChI=1S/C18H20N4O6S3/c1-28-15-6-4-12(10-21-15)11-3-5-14-13(9-11)22-18(29-14)16(30(2,24)25)17(23)20-7-8-31(19,26)27/h3-6,9-10,16H,7-8H2,1-2H3,(H,20,23)(H2,19,26,27)
Standard InChI Key: PLJGPKMVSCCOHP-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
6.4879 -4.9597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1047 -0.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8532 -1.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2514 -2.3421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.3541 -1.3071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.1026 -2.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6034 -2.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3519 -3.9119 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-11.5519 -3.9144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.9499 -4.9523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.7501 -4.9501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.8601 1.2937 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-7.0601 1.2899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4636 2.3310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2637 2.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
6 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
16 17 2 0
17 9 1 0
14 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
24 26 2 0
24 27 1 0
18 28 1 0
28 29 2 0
28 30 2 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.58Molecular Weight (Monoisotopic): 484.0545AlogP: 0.86#Rotatable Bonds: 8Polar Surface Area: 158.41Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.48CX Basic pKa: 2.47CX LogP: -0.18CX LogD: -0.45Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: -1.68
References 1. (2015) Amide, urea or sulfone amide linked benzothiazole inhibitors of endothelial lipase,