US9006282, Example 2, Compound 2::US9102656, Example 2, Compound 1

ID: ALA3677704

PubChem CID: 46894122

Max Phase: Preclinical

Molecular Formula: C29H33FN4O6S

Molecular Weight: 584.67

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC1C[C@H](OC(=O)c2cccnc2)C[C@@H](/C=C/c2c(-c3ccc(F)cc3)nc(N(C)S(C)(=O)=O)nc2C(C)C)O1

Standard InChI:  InChI=1S/C29H33FN4O6S/c1-18(2)26-24(27(19-8-10-21(30)11-9-19)33-29(32-26)34(3)41(5,36)37)13-12-22-15-23(16-25(38-4)39-22)40-28(35)20-7-6-14-31-17-20/h6-14,17-18,22-23,25H,15-16H2,1-5H3/b13-12+/t22-,23-,25?/m1/s1

Standard InChI Key:  WBBZMHQYYBMWIC-OETWXICISA-N

Molfile:  

     RDKit          2D

 41 44  0  0  1  0  0  0  0  0999 V2000
    2.5956   -2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003   -1.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4994   -0.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7985   -1.4932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7985   -2.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4995   -3.7433    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2004   -2.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9008   -3.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6004   -2.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3026   -3.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3050   -5.2480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2667   -5.8497    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6053   -5.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9031   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0967   -3.7463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1370   -3.1481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0946   -5.2471    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1326   -5.8493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0924   -6.4471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0543   -5.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5025    0.7576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5426    1.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4643    1.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031    3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3421    3.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3070    5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6060    6.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6060    7.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3070    8.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0079    7.5003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0079    6.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  3  1  0
  7  9  1  6
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 23 17  1  0
 14 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  2  0
 26 28  2  0
 26 29  1  0
 12 30  1  0
 30 31  1  0
 30 32  1  0
  5 33  1  1
 33 34  1  0
 34 35  2  0
 34 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
M  END

Associated Targets(non-human)

Hmgcr HMG-CoA reductase (1653 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 584.67Molecular Weight (Monoisotopic): 584.2105AlogP: 4.59#Rotatable Bonds: 9
Polar Surface Area: 120.81Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.24CX LogP: 4.51CX LogD: 4.51
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.33Np Likeness Score: -0.10

References

1.  (2015)  Rosuvastatin and atorvastatin derivatives, 

Source

Source(1):