The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9006282, Example 2, Compound 4::US9102656, Example 2, Compound 3 ID: ALA3677706
PubChem CID: 46928592
Max Phase: Preclinical
Molecular Formula: C32H40FN3O5S
Molecular Weight: 597.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC1C[C@H](OCc2ccccc2)C[C@@H](/C=C/c2c(-c3ccc(F)cc3)nc(N(C)S(C)(=O)=O)nc2C(C)C)O1
Standard InChI: InChI=1S/C32H40FN3O5S/c1-21(2)30-28(31(24-12-14-25(33)15-13-24)35-32(34-30)36(5)42(6,37)38)17-16-26-18-27(19-29(41-26)40-22(3)4)39-20-23-10-8-7-9-11-23/h7-17,21-22,26-27,29H,18-20H2,1-6H3/b17-16+/t26-,27-,29?/m1/s1
Standard InChI Key: HPMKWIWLIPTFQV-FJAMEXCJSA-N
Molfile:
RDKit 2D
42 45 0 0 1 0 0 0 0 0999 V2000
3.6331 -3.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 -3.6021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4994 -0.7433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7985 -1.4932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.7985 -2.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4995 -3.7433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2004 -2.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9008 -3.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6004 -2.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 -3.7480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3050 -5.2480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2667 -5.8497 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.6053 -5.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9031 -5.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0967 -3.7463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.1370 -3.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0946 -5.2471 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-10.1326 -5.8493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.0924 -6.4471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.0543 -5.8453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5025 0.7576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5426 1.3561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4643 1.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6060 6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6060 7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 8.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0079 7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0079 6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
9 11 1 6
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
22 24 1 0
24 25 2 0
25 19 1 0
16 26 1 0
26 27 1 0
26 28 1 0
28 29 2 0
28 30 2 0
28 31 1 0
14 32 1 0
32 33 1 0
32 34 1 0
7 35 1 1
35 36 1 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.75Molecular Weight (Monoisotopic): 597.2673AlogP: 6.33#Rotatable Bonds: 11Polar Surface Area: 90.85Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.37CX LogD: 6.37Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.26Np Likeness Score: -0.21
References 1. (2015) Rosuvastatin and atorvastatin derivatives,