US9006282, Example 2, Compound 8::US9102656, Example 2, Compound 8

ID: ALA3677710

PubChem CID: 46928590

Max Phase: Preclinical

Molecular Formula: C28H29F4N3O5S

Molecular Weight: 595.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1/C=C/[C@@H]1C[C@@H](O)CC(Oc2c(F)cc(F)cc2F)O1

Standard InChI:  InChI=1S/C28H29F4N3O5S/c1-15(2)25-21(26(16-5-7-17(29)8-6-16)34-28(33-25)35(3)41(4,37)38)10-9-20-13-19(36)14-24(39-20)40-27-22(31)11-18(30)12-23(27)32/h5-12,15,19-20,24,36H,13-14H2,1-4H3/b10-9+/t19-,20-,24?/m1/s1

Standard InChI Key:  MAPWRPSCIIWUDB-HHFGZVMTSA-N

Molfile:  

     RDKit          2D

 41 44  0  0  1  0  0  0  0  0999 V2000
    3.6387   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6060   -6.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6061   -7.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6453   -8.1002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3071   -8.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0080   -7.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2933   -8.2481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5920   -7.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8937   -8.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8978   -9.4414    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1901   -7.4869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1850   -5.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2221   -5.3834    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8834   -5.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5869   -5.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5456   -5.3994    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0080   -6.0003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1969   -1.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1945   -3.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2328   -3.6062    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5964   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0351    3.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039    3.7494    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3064    4.9494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3443    4.3474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3421    3.1476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 12 11  1  6
 12 13  1  0
 13 14  1  0
 14 15  1  1
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 19  1  0
 26 27  1  0
 17 28  1  0
 28 12  1  0
  8 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 32 34  1  0
 34 35  2  0
 35 29  1  0
  6 36  1  0
 36 37  1  0
 36 38  1  0
 38 39  2  0
 38 40  2  0
 38 41  1  0
M  END

Associated Targets(non-human)

Hmgcr HMG-CoA reductase (1653 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 595.62Molecular Weight (Monoisotopic): 595.1764AlogP: 5.18#Rotatable Bonds: 8
Polar Surface Area: 101.85Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.35CX LogD: 5.35
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.36Np Likeness Score: -0.23

References

1.  (2015)  Rosuvastatin and atorvastatin derivatives, 

Source

Source(1):