US9006282, Example 2, Compound 9::US9102656, Example 2, Compound 9

ID: ALA3677711

PubChem CID: 46928591

Max Phase: Preclinical

Molecular Formula: C30H36FN3O7S

Molecular Weight: 601.70

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(OC2C[C@H](O)C[C@@H](/C=C/c3c(-c4ccc(F)cc4)nc(N(C)S(C)(=O)=O)nc3C(C)C)O2)c(OC)c1

Standard InChI:  InChI=1S/C30H36FN3O7S/c1-18(2)28-24(29(19-7-9-20(31)10-8-19)33-30(32-28)34(3)42(6,36)37)13-11-23-15-21(35)16-27(40-23)41-25-14-12-22(38-4)17-26(25)39-5/h7-14,17-18,21,23,27,35H,15-16H2,1-6H3/b13-11+/t21-,23-,27?/m1/s1

Standard InChI Key:  CQYSSVVEFOVLEM-PCMIMOEYSA-N

Molfile:  

     RDKit          2D

 42 45  0  0  1  0  0  0  0  0999 V2000
    2.5956   -2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5973    1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5951    3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8916    3.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8864    5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9235    5.8621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5847    6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2883    5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2935    3.7495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0125    5.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0155    7.4989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3163    8.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3216    9.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6232   10.4931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9196    9.7386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9145    8.2386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6129    7.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6078    5.9924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3074    5.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3046    3.7446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6023    2.9922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6001    1.7922    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.9027    3.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9054    5.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2235   10.4819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2297   11.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5196    9.7252    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.5621   10.3195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5556    9.1197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5134    8.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0260   10.5051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0318   11.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0164    9.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5972   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5955   -2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  6
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14  8  1  0
 13 15  1  1
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 26 28  1  0
 28 29  2  0
 29 23  1  0
 20 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  2  0
 32 34  2  0
 32 35  1  0
 18 36  1  0
 36 37  1  0
 36 38  1  0
  6 39  1  0
 39 40  1  0
 40 41  1  0
 39 42  2  0
 42  3  1  0
M  END

Associated Targets(non-human)

Hmgcr HMG-CoA reductase (1653 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 601.70Molecular Weight (Monoisotopic): 601.2258AlogP: 4.78#Rotatable Bonds: 10
Polar Surface Area: 120.31Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.60CX LogD: 4.60
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.35Np Likeness Score: -0.14

References

1.  (2015)  Rosuvastatin and atorvastatin derivatives, 

Source

Source(1):