The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9006282, Example 2, Compound 10::US9102656, Example 2, Compound 10 ID: ALA3677712
PubChem CID: 46928487
Max Phase: Preclinical
Molecular Formula: C24H29Cl3FN3O5S
Molecular Weight: 596.94
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1/C=C/[C@@H]1C[C@@H](O)CC(OCC(Cl)(Cl)Cl)O1
Standard InChI: InChI=1S/C24H29Cl3FN3O5S/c1-14(2)21-19(10-9-18-11-17(32)12-20(36-18)35-13-24(25,26)27)22(15-5-7-16(28)8-6-15)30-23(29-21)31(3)37(4,33)34/h5-10,14,17-18,20,32H,11-13H2,1-4H3/b10-9+/t17-,18-,20?/m1/s1
Standard InChI Key: XHZRVKRXKZCVLL-JKHXERJMSA-N
Molfile:
RDKit 2D
37 39 0 0 1 0 0 0 0 0999 V2000
3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6060 -6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6061 -7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6453 -8.1002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3071 -8.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0080 -7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2933 -8.2481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5920 -7.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8932 -8.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9316 -7.6422 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.8953 -9.4437 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.9334 -8.8420 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.0080 -6.0003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 -1.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1945 -3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2328 -3.6062 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5964 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0351 3.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.3064 4.9494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3443 4.3474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3421 3.1476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 2 0
12 11 1 6
12 13 1 0
13 14 1 0
14 15 1 1
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
17 24 1 0
24 12 1 0
8 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
28 30 1 0
30 31 2 0
31 25 1 0
6 32 1 0
32 33 1 0
32 34 1 0
34 35 2 0
34 36 2 0
34 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 596.94Molecular Weight (Monoisotopic): 595.0878AlogP: 5.07#Rotatable Bonds: 8Polar Surface Area: 101.85Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.80CX LogD: 4.80Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: -0.11
References 1. (2015) Rosuvastatin and atorvastatin derivatives,