US9006282, Example 2, Compound 11::US9102656, Example 2, Compound 11

ID: ALA3677713

PubChem CID: 46928593

Max Phase: Preclinical

Molecular Formula: C25H34FN3O5S

Molecular Weight: 507.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCOC1C[C@H](O)C[C@@H](/C=C/c2c(-c3ccc(F)cc3)nc(N(C)S(C)(=O)=O)nc2C(C)C)O1

Standard InChI:  InChI=1S/C25H34FN3O5S/c1-6-13-33-22-15-19(30)14-20(34-22)11-12-21-23(16(2)3)27-25(29(4)35(5,31)32)28-24(21)17-7-9-18(26)10-8-17/h7-12,16,19-20,22,30H,6,13-15H2,1-5H3/b12-11+/t19-,20-,22?/m1/s1

Standard InChI Key:  UCTBEFNFYMBJKW-KKZBYLJVSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  1  0  0  0  0  0999 V2000
    3.8916   -4.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003   -1.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4994   -0.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7985   -1.4932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7985   -2.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4995   -3.7433    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2004   -2.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9008   -3.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6004   -2.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3026   -3.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3050   -5.2480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2667   -5.8497    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6053   -5.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9031   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0967   -3.7463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1370   -3.1481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0946   -5.2471    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1326   -5.8493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0924   -6.4471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0543   -5.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5025    0.7576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5426    1.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4643    1.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  1
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11  5  1  0
 10 12  1  6
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 26 20  1  0
 17 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  2  0
 29 31  2  0
 29 32  1  0
 15 33  1  0
 33 34  1  0
 33 35  1  0
M  END

Associated Targets(non-human)

Hmgcr HMG-CoA reductase (1653 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.63Molecular Weight (Monoisotopic): 507.2203AlogP: 4.11#Rotatable Bonds: 9
Polar Surface Area: 101.85Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.11CX LogD: 4.11
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.55Np Likeness Score: -0.09

References

1.  (2015)  Rosuvastatin and atorvastatin derivatives, 

Source

Source(1):