The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{6-(2,6-Dichloro-phenyl)-2-[3-(4-methyl-piperazin-1-yl)-propylamino]-pyrido[2,3-d]pyrimidin-7-yl}-benzenesulfonamide ID: ALA368189
PubChem CID: 5328181
Max Phase: Preclinical
Molecular Formula: C27H29Cl2N7O2S
Molecular Weight: 586.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(CCCNc2ncc3cc(-c4c(Cl)cccc4Cl)c(NS(=O)(=O)c4ccccc4)nc3n2)CC1
Standard InChI: InChI=1S/C27H29Cl2N7O2S/c1-35-13-15-36(16-14-35)12-6-11-30-27-31-18-19-17-21(24-22(28)9-5-10-23(24)29)26(32-25(19)33-27)34-39(37,38)20-7-3-2-4-8-20/h2-5,7-10,17-18H,6,11-16H2,1H3,(H2,30,31,32,33,34)
Standard InChI Key: YLYQCDIBBXQWFP-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
3.7792 -2.0750 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.4167 -0.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0000 -1.2792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4125 0.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7042 -1.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2667 -1.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9875 -0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9917 0.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9875 0.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6917 0.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5542 -0.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5542 0.1250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9875 -2.2875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6042 -2.0750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0208 -1.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.4458 -1.9292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9917 -2.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2667 0.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7042 0.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9792 1.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1583 -1.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.4458 -1.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7333 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7333 -0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0125 -1.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1125 -0.4042 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.2625 1.9458 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.3000 -0.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5875 -1.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1625 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4125 1.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6917 1.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4167 0.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8708 -0.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7750 -3.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7875 -2.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3667 -3.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3542 -4.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1625 -4.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 1 0
4 2 1 0
5 2 2 0
6 7 2 0
7 5 1 0
8 4 1 0
9 7 1 0
10 4 2 0
11 6 1 0
12 18 1 0
13 1 2 0
14 1 2 0
15 28 1 0
16 23 1 0
17 1 1 0
18 9 2 0
19 8 2 0
20 8 1 0
21 11 1 0
22 24 1 0
23 25 1 0
24 15 1 0
25 15 1 0
26 19 1 0
27 20 1 0
28 29 1 0
29 34 1 0
30 16 1 0
31 32 1 0
32 20 2 0
33 19 1 0
34 21 1 0
35 17 1 0
36 17 2 0
37 36 1 0
38 35 2 0
39 37 2 0
38 39 1 0
10 9 1 0
33 31 2 0
12 11 2 0
22 16 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.55Molecular Weight (Monoisotopic): 585.1480AlogP: 4.85#Rotatable Bonds: 9Polar Surface Area: 103.35Molecular Species: ACIDHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.28CX Basic pKa: 8.05CX LogP: 3.30CX LogD: 3.37Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.27Np Likeness Score: -1.39
References 1. Schroeder MC, Hamby JM, Connolly CJ, Grohar PJ, Winters RT, Barvian MR, Moore CW, Boushelle SL, Crean SM, Kraker AJ, Driscoll DL, Vincent PW, Elliott WL, Lu GH, Batley BL, Dahring TK, Major TC, Panek RL, Doherty AM, Showalter HD.. (2001) Soluble 2-substituted aminopyrido[2,3-d]pyrimidin-7-yl ureas. Structure-activity relationships against selected tyrosine kinases and exploration of in vitro and in vivo anticancer activity., 44 (12): [PMID:11384237 ] [10.1021/jm0004291 ]