The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Biphenyl-2-carboxylic acid [2-[4-(4-methyl-piperazin-1-yl)-butoxy]-4-(5,6,7,8-tetrahydro-thieno[3,2-b]azepine-4-carbonyl)-phenyl]-amide ID: ALA368354
PubChem CID: 11490514
Max Phase: Preclinical
Molecular Formula: C37H42N4O3S
Molecular Weight: 622.84
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(CCCCOc2cc(C(=O)N3CCCCc4sccc43)ccc2NC(=O)c2ccccc2-c2ccccc2)CC1
Standard InChI: InChI=1S/C37H42N4O3S/c1-39-21-23-40(24-22-39)19-9-10-25-44-34-27-29(37(43)41-20-8-7-15-35-33(41)18-26-45-35)16-17-32(34)38-36(42)31-14-6-5-13-30(31)28-11-3-2-4-12-28/h2-6,11-14,16-18,26-27H,7-10,15,19-25H2,1H3,(H,38,42)
Standard InChI Key: SSJBBNZWJHOPCO-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
0.6417 -1.9750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4625 -2.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7000 -5.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8792 -5.0167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 -6.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0667 -3.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1167 -7.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7875 -1.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2750 -4.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7875 -0.3792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.8500 -3.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4542 -3.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7167 1.1208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3542 -0.4875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2708 -1.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3250 -3.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9125 -6.0667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8792 -4.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3292 -7.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4792 -4.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3250 0.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9292 0.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1417 -0.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 0.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4417 -1.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2417 -3.4000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0875 -6.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7292 -7.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1750 -1.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6417 -0.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9000 1.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1542 -8.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7292 -6.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4167 -2.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3875 -1.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8000 -1.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2042 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6917 -6.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5167 -7.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4417 -0.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3667 -8.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9417 -7.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7542 -7.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 5 1 0
5 11 1 0
6 4 1 0
7 3 1 0
8 2 2 0
9 6 2 0
10 2 1 0
11 22 2 0
12 8 1 0
13 7 1 0
14 13 2 0
15 24 1 0
16 31 1 0
17 10 2 0
18 3 2 0
19 4 2 0
20 7 2 0
21 9 1 0
22 20 1 0
23 25 1 0
24 26 1 0
25 16 1 0
26 16 1 0
27 1 1 0
28 14 1 0
29 6 1 0
30 9 1 0
31 37 1 0
32 8 1 0
33 15 1 0
34 21 1 0
35 21 2 0
36 28 1 0
37 39 1 0
38 27 1 0
39 36 1 0
40 29 2 0
41 40 1 0
42 38 1 0
43 34 2 0
44 35 1 0
45 44 2 0
42 32 1 0
12 17 1 0
11 14 1 0
30 41 2 0
23 15 1 0
43 45 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 622.84Molecular Weight (Monoisotopic): 622.2978AlogP: 7.06#Rotatable Bonds: 10Polar Surface Area: 65.12Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.40CX LogP: 6.80CX LogD: 5.75Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.19Np Likeness Score: -1.59
References 1. Cho H, Murakami K, Nakanishi H, Fujisawa A, Isoshima H, Niwa M, Hayakawa K, Hase Y, Uchida I, Watanabe H, Wakitani K, Aisaka K.. (2004) Synthesis and structure-activity relationships of 5,6,7,8-tetrahydro-4H-thieno[3,2-b]azepine derivatives: novel arginine vasopressin antagonists., 47 (1): [PMID:14695824 ] [10.1021/jm030287l ]