The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9102637, 237 ID: ALA3684056
PubChem CID: 118067710
Max Phase: Preclinical
Molecular Formula: C26H22N6O2S
Molecular Weight: 482.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nccn1Cc1ccc(C(=O)Nc2sc(Nc3ccc4ccccc4c3)nc2C(N)=O)cc1
Standard InChI: InChI=1S/C26H22N6O2S/c1-16-28-12-13-32(16)15-17-6-8-19(9-7-17)24(34)31-25-22(23(27)33)30-26(35-25)29-21-11-10-18-4-2-3-5-20(18)14-21/h2-14H,15H2,1H3,(H2,27,33)(H,29,30)(H,31,34)
Standard InChI Key: BDXUSEPHZGIROK-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
10.5463 -13.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3530 -13.8724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3416 -14.9802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9755 -14.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1426 -12.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6029 -12.5881 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2200 -11.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3445 -10.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9594 -8.6328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0818 -7.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5895 -7.5678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9747 -8.9361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8522 -10.1527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7090 -6.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1990 -5.2570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2161 -6.5063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3372 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 -3.8679 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 -3.8595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8372 -5.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9498 -6.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2430 -6.3636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4321 -7.5937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 2 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 24 1 0
29 30 2 0
30 21 1 0
19 31 2 0
31 32 1 0
32 17 2 0
32 33 1 0
33 34 2 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.57Molecular Weight (Monoisotopic): 482.1525AlogP: 4.94#Rotatable Bonds: 7Polar Surface Area: 114.93Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.43CX Basic pKa: 7.04CX LogP: 4.84CX LogD: 4.70Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -1.69
References 1. (2015) Bicyclic thiazole compounds,