US9102637, 237

ID: ALA3684056

PubChem CID: 118067710

Max Phase: Preclinical

Molecular Formula: C26H22N6O2S

Molecular Weight: 482.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nccn1Cc1ccc(C(=O)Nc2sc(Nc3ccc4ccccc4c3)nc2C(N)=O)cc1

Standard InChI:  InChI=1S/C26H22N6O2S/c1-16-28-12-13-32(16)15-17-6-8-19(9-7-17)24(34)31-25-22(23(27)33)30-26(35-25)29-21-11-10-18-4-2-3-5-20(18)14-21/h2-14H,15H2,1H3,(H2,27,33)(H,29,30)(H,31,34)

Standard InChI Key:  BDXUSEPHZGIROK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   10.5463  -13.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3530  -13.8724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3416  -14.9802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9755  -14.3606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1426  -12.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6029  -12.5881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2200  -11.2200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3445  -10.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9594   -8.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0818   -7.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5895   -7.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9747   -8.9361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8522  -10.1527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7090   -6.3524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1990   -5.2570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2161   -6.5063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3372   -5.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8056   -3.8679    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786   -3.8595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -5.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9498   -6.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2430   -6.3636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4321   -7.5937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 24  1  0
 29 30  2  0
 30 21  1  0
 19 31  2  0
 31 32  1  0
 32 17  2  0
 32 33  1  0
 33 34  2  0
 33 35  1  0
M  END

Associated Targets(Human)

TNIK Tchem TRAF2- and NCK-interacting kinase (1174 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.57Molecular Weight (Monoisotopic): 482.1525AlogP: 4.94#Rotatable Bonds: 7
Polar Surface Area: 114.93Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.43CX Basic pKa: 7.04CX LogP: 4.84CX LogD: 4.70
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -1.69

References

1.  (2015)  Bicyclic thiazole compounds, 

Source

Source(1):