The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9102637, 260 ID: ALA3684072
PubChem CID: 118062322
Max Phase: Preclinical
Molecular Formula: C25H21N7O3S
Molecular Weight: 499.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1nc(Nc2ccc3ccccc3c2)sc1NC(=O)c1ccc(Cn2cc(CO)nn2)cc1
Standard InChI: InChI=1S/C25H21N7O3S/c26-22(34)21-24(36-25(28-21)27-19-10-9-16-3-1-2-4-18(16)11-19)29-23(35)17-7-5-15(6-8-17)12-32-13-20(14-33)30-31-32/h1-11,13,33H,12,14H2,(H2,26,34)(H,27,28)(H,29,35)
Standard InChI Key: HZZCXBALRJDSNS-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
3.7262 -7.6017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2161 -6.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4098 -6.3832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3372 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 -3.8679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 -3.8595 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.8372 -5.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9498 -6.4949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5420 -6.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0244 -5.2319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4309 -7.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9222 -7.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8081 -8.5884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2028 -9.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0868 -11.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4792 -12.5461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2381 -13.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2345 -14.9399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5430 -16.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6501 -17.2078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8641 -14.3299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0208 -12.8381 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7116 -10.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8257 -8.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 11 1 0
16 17 2 0
17 8 1 0
6 18 1 0
18 19 1 0
19 4 2 0
19 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
30 33 1 0
33 34 2 0
34 28 1 0
26 35 1 0
35 36 2 0
36 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.56Molecular Weight (Monoisotopic): 499.1427AlogP: 3.52#Rotatable Bonds: 8Polar Surface Area: 148.05Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.38CX Basic pKa: ┄CX LogP: 3.98CX LogD: 3.98Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.26Np Likeness Score: -1.72
References 1. (2015) Bicyclic thiazole compounds,