US9102637, 260

ID: ALA3684072

PubChem CID: 118062322

Max Phase: Preclinical

Molecular Formula: C25H21N7O3S

Molecular Weight: 499.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)c1nc(Nc2ccc3ccccc3c2)sc1NC(=O)c1ccc(Cn2cc(CO)nn2)cc1

Standard InChI:  InChI=1S/C25H21N7O3S/c26-22(34)21-24(36-25(28-21)27-19-10-9-16-3-1-2-4-18(16)11-19)29-23(35)17-7-5-15(6-8-17)12-32-13-20(14-33)30-31-32/h1-11,13,33H,12,14H2,(H2,26,34)(H,27,28)(H,29,35)

Standard InChI Key:  HZZCXBALRJDSNS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    3.7262   -7.6017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2161   -6.5063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4098   -6.3832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3372   -5.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8056   -3.8679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786   -3.8595    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -5.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9498   -6.4949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5420   -6.3307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0244   -5.2319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4309   -7.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9222   -7.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8081   -8.5884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2028   -9.9609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0868  -11.1738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4792  -12.5461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2381  -13.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2345  -14.9399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5430  -16.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6501  -17.2078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8641  -14.3299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0208  -12.8381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7116  -10.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8257   -8.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 11  1  0
 16 17  2  0
 17  8  1  0
  6 18  1  0
 18 19  1  0
 19  4  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 30 33  1  0
 33 34  2  0
 34 28  1  0
 26 35  1  0
 35 36  2  0
 36 23  1  0
M  END

Associated Targets(Human)

TNIK Tchem TRAF2- and NCK-interacting kinase (1174 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.56Molecular Weight (Monoisotopic): 499.1427AlogP: 3.52#Rotatable Bonds: 8
Polar Surface Area: 148.05Molecular Species: NEUTRALHBA: 9HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 12.38CX Basic pKa: CX LogP: 3.98CX LogD: 3.98
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.26Np Likeness Score: -1.72

References

1.  (2015)  Bicyclic thiazole compounds, 

Source

Source(1):