The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Biphenyl-2-carboxylic acid [2-methoxy-4-(5,6,7,8-tetrahydro-thieno[3,2-b]azepine-4-carbonyl)-phenyl]-amide ID: ALA368462
PubChem CID: 11317662
Max Phase: Preclinical
Molecular Formula: C29H26N2O3S
Molecular Weight: 482.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)N2CCCCc3sccc32)ccc1NC(=O)c1ccccc1-c1ccccc1
Standard InChI: InChI=1S/C29H26N2O3S/c1-34-26-19-21(29(33)31-17-8-7-13-27-25(31)16-18-35-27)14-15-24(26)30-28(32)23-12-6-5-11-22(23)20-9-3-2-4-10-20/h2-6,9-12,14-16,18-19H,7-8,13,17H2,1H3,(H,30,32)
Standard InChI Key: LTZZPEJJGSQGSD-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
2.1417 -2.6917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5000 -2.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9625 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2000 -6.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3792 -5.7375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8042 -7.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5667 -4.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5000 -1.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6167 -7.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7125 -2.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7750 -5.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7125 -1.1000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.3500 -3.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9542 -4.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2292 -1.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1750 -3.7417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4125 -6.7875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3792 -4.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8292 -8.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9792 -5.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9417 -2.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7375 -4.1167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5875 -6.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2292 -8.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1417 -0.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6542 -8.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2292 -7.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9167 -3.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3000 -1.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1917 -7.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0167 -8.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9417 -1.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8667 -9.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4417 -7.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2542 -8.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 5 1 0
5 11 1 0
6 4 1 0
7 3 1 0
8 2 2 0
9 6 2 0
10 2 1 0
11 20 2 0
12 8 1 0
13 7 1 0
14 13 2 0
15 10 2 0
16 3 2 0
17 4 2 0
18 7 2 0
19 9 1 0
20 18 1 0
21 1 1 0
22 14 1 0
23 6 1 0
24 9 1 0
25 8 1 0
26 19 1 0
27 19 2 0
28 22 1 0
29 21 1 0
30 23 2 0
31 30 1 0
32 29 1 0
33 26 2 0
34 27 1 0
35 34 2 0
32 25 1 0
12 15 1 0
14 11 1 0
24 31 2 0
33 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.61Molecular Weight (Monoisotopic): 482.1664AlogP: 6.66#Rotatable Bonds: 5Polar Surface Area: 58.64Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.35CX LogD: 6.35Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -1.59
References 1. Itzhak Y, Kalir A, Weissman BA, Cohen S.. (1981) New analgesic drugs derived from phencyclidine., 24 (5): [PMID:7241506 ] [10.1021/jm00137a004 ]