The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8846730, 2 ID: ALA3686282
PubChem CID: 67309265
Max Phase: Preclinical
Molecular Formula: C24H30F3N3O3S
Molecular Weight: 497.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1cn(C[C@H]2CCCO2)/c(=N/C(=O)c2cc(C(F)(F)F)ccc2OC[C@@H]2CCN2)s1
Standard InChI: InChI=1S/C24H30F3N3O3S/c1-23(2,3)20-13-30(12-17-5-4-10-32-17)22(34-20)29-21(31)18-11-15(24(25,26)27)6-7-19(18)33-14-16-8-9-28-16/h6-7,11,13,16-17,28H,4-5,8-10,12,14H2,1-3H3/b29-22-/t16-,17+/m0/s1
Standard InChI Key: CHNFFKTYQXXRJW-XBCNAHOOSA-N
Molfile:
RDKit 2D
34 37 0 0 1 0 0 0 0 0999 V2000
8.6082 -4.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4148 -4.6546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7092 -5.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9024 -5.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8054 -3.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5554 -1.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5517 -0.8722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8550 0.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2794 1.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7162 2.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2162 2.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6857 1.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4759 0.1843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3676 -6.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3069 -7.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2463 -6.2592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0388 3.6015 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.0394 3.6005 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0006 4.2008 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.3382 -2.9741 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
9 8 1 1
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
7 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
24 25 1 0
26 25 1 1
26 27 1 0
27 28 1 0
28 29 1 0
29 26 1 0
20 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
14 34 1 0
34 5 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.58Molecular Weight (Monoisotopic): 497.1960AlogP: 4.53#Rotatable Bonds: 6Polar Surface Area: 64.85Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.66CX LogP: 4.41CX LogD: 2.19Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.64Np Likeness Score: -1.01
References 1. (2014) Compounds as cannabinoid receptor ligands,