The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8846730, 37 ID: ALA3686301
PubChem CID: 68552300
Max Phase: Preclinical
Molecular Formula: C24H26F3N3O4S
Molecular Weight: 509.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1cn(C[C@H]2CCCO2)/c(=N/C(=O)c2cc(C(F)(F)F)ccc2OCc2cnco2)s1
Standard InChI: InChI=1S/C24H26F3N3O4S/c1-23(2,3)20-12-30(11-16-5-4-8-32-16)22(35-20)29-21(31)18-9-15(24(25,26)27)6-7-19(18)33-13-17-10-28-14-34-17/h6-7,9-10,12,14,16H,4-5,8,11,13H2,1-3H3/b29-22-/t16-/m1/s1
Standard InChI Key: FFTZVMFXXOGQGL-PFELRWOZSA-N
Molfile:
RDKit 2D
35 38 0 0 1 0 0 0 0 0999 V2000
8.6082 -4.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4148 -4.6546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7092 -5.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9024 -5.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8054 -3.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5554 -1.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5517 -0.8722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8550 0.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2794 1.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7162 2.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2162 2.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6857 1.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4759 0.1843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5205 -6.1100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0570 -7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5570 -7.5366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0934 -6.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0388 3.6015 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.0394 3.6005 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0006 4.2008 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.3382 -2.9741 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
9 8 1 1
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
7 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 26 2 0
20 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
14 35 1 0
35 5 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.55Molecular Weight (Monoisotopic): 509.1596AlogP: 5.35#Rotatable Bonds: 6Polar Surface Area: 78.85Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.87CX LogP: 4.41CX LogD: 4.41Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.45Np Likeness Score: -1.21
References 1. (2014) Compounds as cannabinoid receptor ligands,