US8846730, 40

ID: ALA3686304

PubChem CID: 67308479

Max Phase: Preclinical

Molecular Formula: C25H33F3N4O4S

Molecular Weight: 542.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(=O)NNc1ccc(C(F)(F)F)cc1C(=O)/N=c1/sc(C(C)(C)C)cn1C[C@H]1CCCO1

Standard InChI:  InChI=1S/C25H33F3N4O4S/c1-23(2,3)19-14-32(13-16-8-7-11-35-16)21(37-19)29-20(33)17-12-15(25(26,27)28)9-10-18(17)30-31-22(34)36-24(4,5)6/h9-10,12,14,16,30H,7-8,11,13H2,1-6H3,(H,31,34)/b29-21+/t16-/m1/s1

Standard InChI Key:  DFFMMMQYOJBYBS-DZFJRQEYSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  1  0  0  0  0  0999 V2000
    8.8387   -0.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8003   -1.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8024   -2.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8405   -2.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2024   -2.6932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0351   -3.6026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5241   -6.1051    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0664   -7.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5664   -7.5397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0970   -6.1150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3272   -5.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4447   -6.6518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8956   -6.3252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6457   -7.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6421   -8.7390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2717   -8.1290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9520   -8.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1450   -8.6124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4681   -9.8401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6609   -9.7103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5988    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5996    2.7004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6378    0.9001    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6383    2.0999    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
 23 24  1  0
 25 24  1  1
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 25  1  0
 21 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
 13 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
M  END

Associated Targets(Human)

CNR2 Tchem Cannabinoid CB2 receptor (16942 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cnr2 Cannabinoid CB2 receptor (721 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 542.62Molecular Weight (Monoisotopic): 542.2175AlogP: 5.64#Rotatable Bonds: 5
Polar Surface Area: 93.95Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.56CX Basic pKa: 1.86CX LogP: 6.41CX LogD: 6.41
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.48Np Likeness Score: -1.38

References

1.  (2014)  Compounds as cannabinoid receptor ligands, 

Source

Source(1):