US8846730, 44

ID: ALA3686307

PubChem CID: 68553776

Max Phase: Preclinical

Molecular Formula: C25H32F3N3O3S

Molecular Weight: 511.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)c1cn(C[C@H]2CCCO2)/c(=N/C(=O)c2cc(C(F)(F)F)ccc2OC[C@@H]2CCCN2)s1

Standard InChI:  InChI=1S/C25H32F3N3O3S/c1-24(2,3)21-14-31(13-18-7-5-11-33-18)23(35-21)30-22(32)19-12-16(25(26,27)28)8-9-20(19)34-15-17-6-4-10-29-17/h8-9,12,14,17-18,29H,4-7,10-11,13,15H2,1-3H3/b30-23-/t17-,18+/m0/s1

Standard InChI Key:  QSGIWDBKEJQVSN-KCRJNBJESA-N

Molfile:  

     RDKit          2D

 35 38  0  0  1  0  0  0  0  0999 V2000
    8.6082   -4.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4148   -4.6546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7092   -5.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9024   -5.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8054   -3.2859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5554   -1.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5517   -0.8722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8550    0.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2794    1.0677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7162    2.4894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2162    2.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6857    1.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4759    0.1843    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5205   -6.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0570   -7.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5570   -7.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0934   -6.1100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0388    3.6015    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0394    3.6005    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0006    4.2008    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.3382   -2.9741    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  9  8  1  1
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
  7 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 23 24  1  0
 24 25  1  0
 26 25  1  1
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 26  1  0
 20 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
 14 35  1  0
 35  5  1  0
M  END

Associated Targets(Human)

CNR2 Tchem Cannabinoid CB2 receptor (16942 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cnr2 Cannabinoid CB2 receptor (721 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.61Molecular Weight (Monoisotopic): 511.2116AlogP: 4.92#Rotatable Bonds: 6
Polar Surface Area: 64.85Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.33CX LogP: 4.93CX LogD: 2.17
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.60Np Likeness Score: -1.01

References

1.  (2014)  Compounds as cannabinoid receptor ligands, 

Source

Source(1):