The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8846730, 46 ID: ALA3686309
PubChem CID: 68555029
Max Phase: Preclinical
Molecular Formula: C28H38F3N3O3S
Molecular Weight: 553.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)N1CCC[C@H]1COc1ccc(C(F)(F)F)cc1C(=O)/N=c1\sc(C(C)(C)C)cn1C[C@H]1CCCO1
Standard InChI: InChI=1S/C28H38F3N3O3S/c1-18(2)34-12-6-8-20(34)17-37-23-11-10-19(28(29,30)31)14-22(23)25(35)32-26-33(15-21-9-7-13-36-21)16-24(38-26)27(3,4)5/h10-11,14,16,18,20-21H,6-9,12-13,15,17H2,1-5H3/b32-26-/t20-,21+/m0/s1
Standard InChI Key: ALFABUCBNSTHNO-DAAIBCRRSA-N
Molfile:
RDKit 2D
38 41 0 0 1 0 0 0 0 0999 V2000
7.9939 0.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8550 0.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9584 1.3926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5517 -0.8722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5554 -1.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8054 -3.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3382 -2.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0351 -3.6026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0934 -6.1101 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.5570 -7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0570 -7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5205 -6.1100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9427 -5.6391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0643 -6.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5139 -6.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2694 -7.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2704 -8.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8975 -8.1142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3237 -8.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5172 -8.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1648 -9.8448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0285 -9.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5996 2.7004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6378 0.9001 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6383 2.0999 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
8 9 1 1
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
17 18 2 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 1 0
24 25 1 0
26 25 1 6
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 26 1 0
22 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
14 35 1 0
35 36 1 0
35 37 1 0
35 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.69Molecular Weight (Monoisotopic): 553.2586AlogP: 6.04#Rotatable Bonds: 7Polar Surface Area: 56.06Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.41CX LogP: 6.08CX LogD: 5.04Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.42Np Likeness Score: -1.26
References 1. (2014) Compounds as cannabinoid receptor ligands,